The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-Amino-6-(3,5-di-tert-butyl-4-methoxyphenyl)-2-phenyl-1,2,4-triazolo[4,3-a]pyrazin-3(2H)-one ID: ALA4560207
PubChem CID: 155558350
Max Phase: Preclinical
Molecular Formula: C26H31N5O2
Molecular Weight: 445.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1c(C(C)(C)C)cc(-c2cn3c(=O)n(-c4ccccc4)nc3c(N)n2)cc1C(C)(C)C
Standard InChI: InChI=1S/C26H31N5O2/c1-25(2,3)18-13-16(14-19(21(18)33-7)26(4,5)6)20-15-30-23(22(27)28-20)29-31(24(30)32)17-11-9-8-10-12-17/h8-15H,1-7H3,(H2,27,28)
Standard InChI Key: SAVMBELDOOXVNX-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
31.7287 -10.1406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7276 -10.9601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4356 -11.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4338 -9.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1424 -10.1370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1427 -10.9556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9214 -11.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4024 -10.5459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9209 -9.8838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2164 -10.5468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6247 -11.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4411 -11.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8502 -10.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4370 -9.8377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6219 -9.8412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1741 -11.9855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4314 -8.9145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0214 -11.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3138 -10.9575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6062 -11.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6051 -12.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3175 -12.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0221 -12.1823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8976 -12.5919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1897 -12.1837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3197 -13.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6131 -13.8197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0286 -13.8158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3145 -14.2224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8990 -10.9554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9001 -10.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1908 -11.3631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1890 -10.5451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 6 1 0
5 4 1 0
4 1 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 2 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
7 16 2 0
4 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
2 18 1 0
21 24 1 0
24 25 1 0
22 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
20 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.57Molecular Weight (Monoisotopic): 445.2478AlogP: 4.73#Rotatable Bonds: 3Polar Surface Area: 87.44Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.02CX LogP: 5.41CX LogD: 5.26Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -0.70
References 1. Falsini M, Catarzi D, Varano F, Ceni C, Dal Ben D, Marucci G, Buccioni M, Volpini R, Di Cesare Mannelli L, Lucarini E, Ghelardini C, Bartolucci G, Menicatti M, Colotta V.. (2019) Antioxidant-Conjugated 1,2,4-Triazolo[4,3-a ]pyrazin-3-one Derivatives: Highly Potent and Selective Human A2A Adenosine Receptor Antagonists Possessing Protective Efficacy in Neuropathic Pain., 62 (18): [PMID:31453698 ] [10.1021/acs.jmedchem.9b00778 ]