8-Amino-6-(3,5-di-tert-butyl-4-methoxyphenyl)-2-phenyl-1,2,4-triazolo[4,3-a]pyrazin-3(2H)-one

ID: ALA4560207

PubChem CID: 155558350

Max Phase: Preclinical

Molecular Formula: C26H31N5O2

Molecular Weight: 445.57

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1c(C(C)(C)C)cc(-c2cn3c(=O)n(-c4ccccc4)nc3c(N)n2)cc1C(C)(C)C

Standard InChI:  InChI=1S/C26H31N5O2/c1-25(2,3)18-13-16(14-19(21(18)33-7)26(4,5)6)20-15-30-23(22(27)28-20)29-31(24(30)32)17-11-9-8-10-12-17/h8-15H,1-7H3,(H2,27,28)

Standard InChI Key:  SAVMBELDOOXVNX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   31.7287  -10.1406    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.7276  -10.9601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4356  -11.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4338   -9.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1424  -10.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1427  -10.9556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9214  -11.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4024  -10.5459    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9209   -9.8838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.2164  -10.5468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6247  -11.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4411  -11.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8502  -10.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4370   -9.8377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6219   -9.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1741  -11.9855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4314   -8.9145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0214  -11.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3138  -10.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6062  -11.3649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6051  -12.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3175  -12.5920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0221  -12.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8976  -12.5919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1897  -12.1837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3197  -13.4092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6131  -13.8197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0286  -13.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3145  -14.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8990  -10.9554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9001  -10.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1908  -11.3631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1890  -10.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  4  1  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
  7 16  2  0
  4 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  2 18  1  0
 21 24  1  0
 24 25  1  0
 22 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
 20 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4560207

    ---

Associated Targets(Human)

ADORA2A Tclin Adenosine A2a receptor (16305 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADORA1 Tclin Adenosine A1 receptor (17603 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADORA3 Tchem Adenosine A3 receptor (15931 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADORA2B Tclin Adenosine A2b receptor (7672 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.57Molecular Weight (Monoisotopic): 445.2478AlogP: 4.73#Rotatable Bonds: 3
Polar Surface Area: 87.44Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.02CX LogP: 5.41CX LogD: 5.26
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -0.70

References

1. Falsini M, Catarzi D, Varano F, Ceni C, Dal Ben D, Marucci G, Buccioni M, Volpini R, Di Cesare Mannelli L, Lucarini E, Ghelardini C, Bartolucci G, Menicatti M, Colotta V..  (2019)  Antioxidant-Conjugated 1,2,4-Triazolo[4,3-a]pyrazin-3-one Derivatives: Highly Potent and Selective Human A2A Adenosine Receptor Antagonists Possessing Protective Efficacy in Neuropathic Pain.,  62  (18): [PMID:31453698] [10.1021/acs.jmedchem.9b00778]

Source