N-(3-Methoxybenzyl)-N-methyl-2-(3-phenyl-9H-carbazol-9-yl)acetamide

ID: ALA4560218

PubChem CID: 155558424

Max Phase: Preclinical

Molecular Formula: C29H26N2O2

Molecular Weight: 434.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(CN(C)C(=O)Cn2c3ccccc3c3cc(-c4ccccc4)ccc32)c1

Standard InChI:  InChI=1S/C29H26N2O2/c1-30(19-21-9-8-12-24(17-21)33-2)29(32)20-31-27-14-7-6-13-25(27)26-18-23(15-16-28(26)31)22-10-4-3-5-11-22/h3-18H,19-20H2,1-2H3

Standard InChI Key:  PQLFAOJJKWOKRN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   16.5213   -3.6402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1127   -4.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8629   -4.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0678   -3.9532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5217   -4.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7762   -5.3352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5707   -5.5017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1842   -4.1223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9280   -4.8965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4699   -5.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2680   -5.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5214   -4.5590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9779   -3.9554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5195   -2.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2263   -2.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2246   -1.5957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9349   -2.8200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9314   -1.1856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5160   -1.1886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6400   -1.5927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6376   -2.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3453   -2.8143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0531   -2.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0487   -1.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3404   -1.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7541   -1.1701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4641   -1.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8115   -5.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5555   -6.7196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1000   -7.3279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9007   -7.1602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1540   -6.3788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6077   -5.7739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  9  1  0
  8  1  1  0
  1  3  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  1 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 16 19  1  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 24 26  1  0
 26 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 11 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4560218

    ---

Associated Targets(Human)

TSPO Tchem Translocator protein (484 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.54Molecular Weight (Monoisotopic): 434.1994AlogP: 6.13#Rotatable Bonds: 6
Polar Surface Area: 34.47Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.65CX LogD: 5.65
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -1.17

References

1. Cheng HWA, Sokias R, Werry EL, Ittner LM, Reekie TA, Du J, Gao Q, Hibbs DE, Kassiou M..  (2019)  First Nondiscriminating Translocator Protein Ligands Produced from a Carbazole Scaffold.,  62  (17): [PMID:31419132] [10.1021/acs.jmedchem.9b00980]

Source