The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-N-[4-[[3-[[5-(Trifluoromethyl)-2-pyridyl]oxy]phenyl]methylene]cyclohexyl]pyridine-3-carboxamide ID: ALA4560227
Max Phase: Preclinical
Molecular Formula: C25H22F3N3O2
Molecular Weight: 453.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC1CCC(=Cc2cccc(Oc3ccc(C(F)(F)F)cn3)c2)CC1)c1cccnc1
Standard InChI: InChI=1S/C25H22F3N3O2/c26-25(27,28)20-8-11-23(30-16-20)33-22-5-1-3-18(14-22)13-17-6-9-21(10-7-17)31-24(32)19-4-2-12-29-15-19/h1-5,8,11-16,21H,6-7,9-10H2,(H,31,32)/b17-13-
Standard InChI Key: PAIPLWPUQXJMMT-LGMDPLHJSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
4.9693 -4.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9681 -5.0147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6830 -5.4275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3993 -5.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3965 -4.1837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6811 -3.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2565 -3.7716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6063 -3.3965 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.1188 -2.9206 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.4508 -4.0782 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.1145 -5.4256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8282 -5.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5400 -5.4238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2533 -5.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2525 -4.1850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5324 -3.7738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8219 -4.1891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9682 -5.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6822 -5.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3941 -5.4257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1060 -5.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1093 -4.1907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3946 -3.7768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6765 -4.1881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8249 -3.7801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5382 -4.1945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2538 -3.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5360 -5.0195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9661 -4.2010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6811 -3.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6838 -2.9652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9654 -2.5510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2533 -2.9632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
7 9 1 0
7 10 1 0
1 7 1 0
4 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
14 18 1 0
18 19 2 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 27 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.46Molecular Weight (Monoisotopic): 453.1664AlogP: 6.04#Rotatable Bonds: 5Polar Surface Area: 64.11Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.95CX Basic pKa: 3.62CX LogP: 4.93CX LogD: 4.93Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.39
References 1. Bhuniya D, Kharul RK, Hajare A, Shaikh N, Bhosale S, Balwe S, Begum F, De S, Athavankar S, Joshi D, Madgula V, Joshi K, Raje AA, Meru AV, Magdum A, Mookhtiar KA, Barbhaiya R.. (2019) Discovery and evaluation of novel FAAH inhibitors in neuropathic pain model., 29 (2): [PMID:30503633 ] [10.1016/j.bmcl.2018.11.048 ]