Bencycloquidium bromide

ID: ALA4560341

Cas Number: 860804-18-8

PubChem CID: 11531643

Max Phase: Unknown

Molecular Formula: C21H32BrNO2

Molecular Weight: 330.49

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Synonyms: Bencycloquidium bromide | Bencycloquidium Bromide|860804-18-8|CHEMBL4560341|3-(2-cyclopentyl-2-hydroxy-2-phenylethoxy)-1-methylquinuclidin-1-ium bromide|BDBM50528213|AKOS040747943|HY-108030|CS-0027192|1-cyclopentyl-2-[(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)oxy]-1-phenylethanol;bromide|1-Azoniabicyclo[2.2.2]octane, 3-(2-cyclopentyl-2-hydroxy-2-phenylethoxy)-1-methyl-, bromide (1:1)

Canonical SMILES:  C[N+]12CCC(CC1)C(OCC(O)(c1ccccc1)C1CCCC1)C2.[Br-]

Standard InChI:  InChI=1S/C21H32NO2.BrH/c1-22-13-11-17(12-14-22)20(15-22)24-16-21(23,19-9-5-6-10-19)18-7-3-2-4-8-18;/h2-4,7-8,17,19-20,23H,5-6,9-16H2,1H3;1H/q+1;/p-1

Standard InChI Key:  LMUJEWVKOCYOQL-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    9.2387   -8.6429    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    6.9427   -7.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3527   -6.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1502   -6.5624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9479   -6.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5072   -7.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7097   -7.2764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6296   -6.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0816   -5.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7097   -8.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7687   -6.1987    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9685   -6.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3844   -5.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5842   -6.0389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3718   -6.8391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5747   -7.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9904   -6.4649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1989   -5.6698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9966   -5.4513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9726   -5.1105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1478   -5.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9748   -4.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6947   -3.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3081   -4.3515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9685   -5.2386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  5  4  1  0
  6  5  1  0
  6  7  1  0
  2  7  1  0
  7  8  1  0
  8  9  1  0
  4  9  1  0
  7 10  1  0
  3 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 14 19  1  0
 13 20  1  0
 21 20  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
 13 25  1  0
M  CHG  2   1  -1   7   1
M  END

Associated Targets(Human)

CHRM2 Tclin Muscarinic acetylcholine receptor M2 (10671 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 330.49Molecular Weight (Monoisotopic): 330.2428AlogP: 3.32#Rotatable Bonds: 5
Polar Surface Area: 29.46Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.13CX Basic pKa: CX LogP: -0.97CX LogD: -0.97
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.84Np Likeness Score: 0.43

References

1. Ti H, Zhou Y, Liang X, Li R, Ding K, Zhao X..  (2019)  Targeted Treatments for Chronic Obstructive Pulmonary Disease (COPD) Using Low-Molecular-Weight Drugs (LMWDs).,  62  (13): [PMID:30682248] [10.1021/acs.jmedchem.8b01520]
2. Unpublished dataset,