(1S,2R,4aS,6aS,6bR,10E,12aR)-4-fluorobenzyl 10-guanidinoimino-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydro-1,2,6a,6b,9,9,12a-heptamethylpicene-4a-carboxylate

ID: ALA4560346

PubChem CID: 155558225

Max Phase: Preclinical

Molecular Formula: C38H55FN4O2

Molecular Weight: 618.88

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H]1[C@H](C)CC[C@]2(C(=O)OCc3ccc(F)cc3)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC/C(=N\NC(=N)N)C(C)(C)[C@@H]5CC[C@]43C)[C@H]12

Standard InChI:  InChI=1S/C38H55FN4O2/c1-23-14-19-38(32(44)45-22-25-8-10-26(39)11-9-25)21-20-36(6)27(31(38)24(23)2)12-13-29-35(5)17-16-30(42-43-33(40)41)34(3,4)28(35)15-18-37(29,36)7/h8-12,23-24,28-29,31H,13-22H2,1-7H3,(H4,40,41,43)/b42-30+/t23-,24+,28+,29-,31+,35+,36-,37-,38+/m1/s1

Standard InChI Key:  HBEGAWRIAWYOMY-QYZUVDAWSA-N

Molfile:  

 
     RDKit          2D

 48 53  0  0  0  0  0  0  0  0999 V2000
    8.4856  -27.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4732  -28.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7716  -29.0763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1913  -27.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3559  -29.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8971  -27.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0617  -28.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3601  -29.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7716  -27.4337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6502  -30.3021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6029  -28.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2037  -26.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1790  -29.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7716  -29.8935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0617  -27.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8971  -28.6801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6502  -28.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0617  -30.3021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6152  -27.4585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9485  -29.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3086  -27.8629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9219  -26.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9485  -29.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6276  -26.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4732  -29.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6029  -29.0887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7674  -28.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3559  -28.2633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2333  -31.0079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0505  -31.0079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2387  -30.3062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4897  -26.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9342  -25.3990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1913  -28.2591    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0617  -29.4849    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3559  -30.7107    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5315  -29.8967    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8232  -30.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1161  -29.8948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8222  -31.1216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0168  -28.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7240  -27.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4298  -28.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1365  -27.8617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1360  -27.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4228  -26.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7190  -27.0472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8426  -26.6333    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  1  1  0
  5  7  1  0
  6  4  1  0
  7 15  1  0
  8  5  1  0
  9  1  2  0
 10  8  1  0
  6 11  1  1
 12  4  1  0
 13  2  1  0
 14  3  1  0
 15  9  1  0
 16  6  1  0
 17  5  1  0
 18 14  1  0
 19  6  1  0
 20 23  1  0
 21 11  1  0
 22 12  1  0
 23 17  1  0
 24 22  1  0
  2 25  1  6
 26 11  2  0
  3 27  1  1
  5 28  1  1
 29 10  1  0
 30 10  1  0
 20 31  2  0
 12 32  1  1
 22 33  1  6
  4 34  1  1
  7 35  1  6
  8 36  1  6
  3  7  1  0
 13 16  1  0
 19 24  1  0
  8 18  1  0
 10 20  1  0
 31 37  1  0
 37 38  1  0
 38 39  1  0
 38 40  2  0
 21 41  1  0
 41 42  1  0
 42 43  2  0
 43 44  1  0
 44 45  2  0
 45 46  1  0
 46 47  2  0
 47 42  1  0
 45 48  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4560346

    ---

Associated Targets(Human)

HIF1A Tchem Hypoxia-inducible factor 1 alpha (6027 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Hep 3B2 (2332 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 618.88Molecular Weight (Monoisotopic): 618.4309AlogP: 8.37#Rotatable Bonds: 4
Polar Surface Area: 100.56Molecular Species: BASEHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.55CX LogP: 8.44CX LogD: 6.48
Aromatic Rings: 1Heavy Atoms: 45QED Weighted: 0.10Np Likeness Score: 1.76

References

1. Wu J, Zhang ZH, Zhang LH, Jin XJ, Ma J, Piao HR..  (2019)  Design, synthesis, and screening of novel ursolic acid derivatives as potential anti-cancer agents that target the HIF-1α pathway.,  29  (6): [PMID:30728113] [10.1016/j.bmcl.2018.12.060]

Source