(1R,3R,3aS,6aS,7R,9aR,10aS)-7-((S)-1,5-Dimethyl-hexa-2,4-dienyl)-1,3-dihydroxy-1,9a-dimethyl-1,2,3,3a,6,6a,7,8,9,9a,10,10a-dodecahydro-dicyclopenta[a,d]cyclooctene-4-carbaldehyde

ID: ALA4560413

PubChem CID: 155558263

Max Phase: Preclinical

Molecular Formula: C25H38O3

Molecular Weight: 386.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)=C/C=C\[C@H](C)[C@H]1CC[C@]2(C)C[C@H]3[C@@H](/C(C=O)=C\C[C@@H]12)[C@H](O)C[C@@]3(C)O

Standard InChI:  InChI=1S/C25H38O3/c1-16(2)7-6-8-17(3)19-11-12-24(4)13-21-23(22(27)14-25(21,5)28)18(15-26)9-10-20(19)24/h6-9,15,17,19-23,27-28H,10-14H2,1-5H3/b8-6-,18-9-/t17-,19+,20-,21-,22+,23+,24+,25+/m0/s1

Standard InChI Key:  FOEYJNQZQGLUKQ-PISKASOISA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    5.2829  -27.2603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5771  -26.8517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5761  -27.6672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9494  -24.1561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7690  -26.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7690  -24.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9495  -26.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7752  -26.7217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3808  -25.5559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3743  -24.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5985  -25.8169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3441  -24.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3433  -25.5501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1218  -25.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6039  -25.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1232  -24.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3530  -26.8352    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3353  -26.3647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3765  -23.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9078  -24.2640    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1760  -23.5330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8303  -23.0942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7222  -24.1408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4689  -24.9178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0151  -25.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7618  -26.3025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8146  -25.3565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5540  -23.9379    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6181  -24.4214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5082  -23.6117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6691  -25.1472    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8926  -25.4052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
 10  4  2  0
  7  5  1  0
  5 13  1  0
 12  6  1  0
  6  4  1  0
  7  9  1  0
 11  8  1  0
  8  2  1  0
  2  7  1  0
  9 10  1  0
 11  9  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
  7 17  1  1
 13 18  1  1
 16 19  1  0
 16 20  1  6
 19 21  1  0
 19 22  1  1
 21 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 25 27  1  0
 12 28  1  6
 10 29  1  0
 29 30  2  0
  9 31  1  1
 11 32  1  1
  2  1  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4560413

    ---

Associated Targets(non-human)

ptbB Phosphotyrosine protein phosphatase (409 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RAW264.7 (28094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 386.58Molecular Weight (Monoisotopic): 386.2821AlogP: 4.84#Rotatable Bonds: 4
Polar Surface Area: 57.53Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.79CX LogD: 3.79
Aromatic Rings: Heavy Atoms: 28QED Weighted: 0.54Np Likeness Score: 2.92

References

1. Cai R, Jiang H, Mo Y, Guo H, Li C, Long Y, Zang Z, She Z..  (2019)  Ophiobolin-Type Sesterterpenoids from the Mangrove Endophytic Fungus Aspergillus sp. ZJ-68.,  82  (8): [PMID:31365251] [10.1021/acs.jnatprod.9b00462]

Source