Acetic acid 2-[2-[(2-ethyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene)hydrazono]-3-(4-hydroxyphenyl)4-oxothiazolidin-5-yl]ethyl ester

ID: ALA4560449

PubChem CID: 155558496

Max Phase: Preclinical

Molecular Formula: C26H24N6O4S2

Molecular Weight: 548.65

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1nn2c(/C=N/N=C3\SC(CCOC(C)=O)C(=O)N3c3ccc(O)cc3)c(-c3ccccc3)nc2s1

Standard InChI:  InChI=1S/C26H24N6O4S2/c1-3-22-30-32-20(23(28-25(32)38-22)17-7-5-4-6-8-17)15-27-29-26-31(18-9-11-19(34)12-10-18)24(35)21(37-26)13-14-36-16(2)33/h4-12,15,21,34H,3,13-14H2,1-2H3/b27-15+,29-26-

Standard InChI Key:  JBWDBPSWFLHOPN-FQVPYNAUSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   21.5730   -8.1410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5546   -6.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0828   -7.4773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3471   -7.0448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3563   -7.8720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1460   -8.1218    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.6266   -7.4464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1312   -6.7818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2604   -7.4898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8356   -6.7771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0093   -6.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6070   -7.5113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0328   -8.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8576   -8.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2886   -6.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4771   -5.8581    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2110   -5.0751    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3994   -4.9161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0469   -4.1688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2256   -4.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0666   -5.0787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7896   -5.4793    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.6658   -3.6597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3205   -5.4261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6467   -4.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4421   -3.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2661   -3.4387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6645   -2.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2401   -2.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4130   -2.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0184   -2.7507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6376   -1.2927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9006   -5.3009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2268   -4.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4807   -5.1757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2990   -4.0086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.4495   -7.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8689   -8.1453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  2  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  3  9  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
 20 23  2  0
 21 24  1  0
 24 25  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 19 26  1  0
 29 32  1  0
 25 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
  7 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4560449

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 548.65Molecular Weight (Monoisotopic): 548.1300AlogP: 4.52#Rotatable Bonds: 8
Polar Surface Area: 121.75Molecular Species: NEUTRALHBA: 11HBD: 1
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.30CX Basic pKa: 1.96CX LogP: 4.66CX LogD: 4.61
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.20Np Likeness Score: -1.11

References

1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R..  (2019)  Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents.,  174  [PMID:31051403] [10.1016/j.ejmech.2019.04.052]

Source