2-(2-Methylphenoxy)-N-(3-pyridylmethyl)acetamide

ID: ALA4560510

PubChem CID: 811627

Max Phase: Preclinical

Molecular Formula: C15H16N2O2

Molecular Weight: 256.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccccc1OCC(=O)NCc1cccnc1

Standard InChI:  InChI=1S/C15H16N2O2/c1-12-5-2-3-7-14(12)19-11-15(18)17-10-13-6-4-8-16-9-13/h2-9H,10-11H2,1H3,(H,17,18)

Standard InChI Key:  IMDWRCZDTSIUEN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
   21.2414   -2.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2403   -3.3743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9483   -3.7832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6580   -3.3738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6552   -2.5511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9465   -2.1459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3613   -2.1399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0706   -2.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7767   -2.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4860   -2.5405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7737   -1.3173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1921   -2.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9441   -1.3287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9014   -2.5351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9016   -3.3524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6100   -3.7582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6025   -2.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3132   -2.5267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3193   -3.3438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
  6 13  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 19  2  0
 17 14  1  0
 17 18  2  0
 18 19  1  0
M  END

Alternative Forms

Associated Targets(Human)

NOTUM Tchem Palmitoleoyl-protein carboxylesterase NOTUM (562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 256.31Molecular Weight (Monoisotopic): 256.1212AlogP: 2.09#Rotatable Bonds: 5
Polar Surface Area: 51.22Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.56CX Basic pKa: 4.82CX LogP: 1.73CX LogD: 1.73
Aromatic Rings: 2Heavy Atoms: 19QED Weighted: 0.89Np Likeness Score: -1.87

References

1. Atkinson BN, Steadman D, Zhao Y, Sipthorp J, Vecchia L, Ruza RR, Jeganathan F, Lines G, Frew S, Monaghan A, Kjær S, Bictash M, Jones EY, Fish PV..  (2019)  Discovery of 2-phenoxyacetamides as inhibitors of the Wnt-depalmitoleating enzyme NOTUM from an X-ray fragment screen.,  10  (8): [PMID:31534655] [10.1039/C9MD00096H]

Source