(E)-4-(3-(3-Cyanophenyl)acryloyl)-N-cyclopropylbenzenesulfonamide

ID: ALA4560739

PubChem CID: 155558593

Max Phase: Preclinical

Molecular Formula: C19H16N2O3S

Molecular Weight: 352.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1cccc(/C=C/C(=O)c2ccc(S(=O)(=O)NC3CC3)cc2)c1

Standard InChI:  InChI=1S/C19H16N2O3S/c20-13-15-3-1-2-14(12-15)4-11-19(22)16-5-9-18(10-6-16)25(23,24)21-17-7-8-17/h1-6,9-12,17,21H,7-8H2/b11-4+

Standard InChI Key:  ORFZFCXMPHRQOS-NYYWCZLTSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   38.8042  -20.4711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.2169  -19.7653    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   38.3994  -19.7607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.9254  -20.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9242  -20.9934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6323  -21.4024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3420  -20.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3391  -20.1703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6305  -19.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0503  -21.4004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0516  -22.2176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.7574  -20.9907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7561  -20.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4632  -19.7638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1691  -20.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8757  -19.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8749  -18.9452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1615  -18.5379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4579  -18.9493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2174  -18.9482    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.1546  -17.7209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1504  -16.9037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.5099  -18.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0996  -17.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6906  -18.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  7 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  4  2  1  0
  2 20  1  0
 21 22  3  0
 18 21  1  0
 20 23  1  0
 24 23  1  0
 25 24  1  0
 23 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4560739

    ---

Associated Targets(Human)

U-87 MG (3946 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
P4HB Tchem Protein disulfide-isomerase (716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A 172 (535 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 352.42Molecular Weight (Monoisotopic): 352.0882AlogP: 2.90#Rotatable Bonds: 6
Polar Surface Area: 87.03Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.86CX Basic pKa: CX LogP: 3.04CX LogD: 3.04
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.64Np Likeness Score: -1.37

References

1. Yang S, Shergalis A, Lu D, Kyani A, Liu Z, Ljungman M, Neamati N..  (2019)  Design, Synthesis, and Biological Evaluation of Novel Allosteric Protein Disulfide Isomerase Inhibitors.,  62  (7): [PMID:30759340] [10.1021/acs.jmedchem.8b01951]

Source