The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Asperversiamide P ID: ALA4560821
PubChem CID: 145721075
Max Phase: Preclinical
Molecular Formula: C26H31N3O5
Molecular Weight: 465.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(C)(C)[C@]1(CC2NC(=O)C3(O)CCCN3C2=O)C(=O)Nc2cc3c(cc21)C=CC(C)(C)O3
Standard InChI: InChI=1S/C26H31N3O5/c1-6-23(2,3)25(14-18-20(30)29-11-7-9-26(29,33)22(32)28-18)16-12-15-8-10-24(4,5)34-19(15)13-17(16)27-21(25)31/h6,8,10,12-13,18,33H,1,7,9,11,14H2,2-5H3,(H,27,31)(H,28,32)/t18?,25-,26?/m0/s1
Standard InChI Key: UKWXCGLNZUXOIN-FHZBLKBXSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
34.5573 -8.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5614 -9.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2671 -9.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7652 -12.0808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1779 -11.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3604 -11.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2949 -11.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2931 -10.1572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5869 -11.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5910 -10.5705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8910 -10.1617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1825 -10.5635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8829 -11.7918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0018 -10.5624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0066 -11.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7866 -11.6295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7788 -10.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2657 -10.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2542 -9.6387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0348 -9.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0387 -10.7018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.7443 -11.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7366 -9.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7470 -11.9220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7316 -8.6534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.4468 -9.8781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.4522 -10.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2308 -10.9423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7066 -10.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2220 -9.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4463 -11.5108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0513 -11.1724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7710 -9.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5557 -8.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
9 7 1 0
7 15 2 0
14 8 2 0
8 10 1 0
9 10 2 0
9 13 1 0
10 11 1 0
11 12 2 0
12 5 1 0
5 13 1 0
14 15 1 0
15 16 1 0
16 18 1 0
17 14 1 0
17 18 1 0
20 19 1 0
19 17 1 0
20 21 1 0
20 23 1 0
21 22 1 0
22 27 1 0
26 23 1 0
22 24 2 0
23 25 2 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 26 1 0
27 31 1 0
18 32 2 0
17 2 1 6
2 33 1 0
33 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.55Molecular Weight (Monoisotopic): 465.2264AlogP: 2.47#Rotatable Bonds: 4Polar Surface Area: 107.97Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.46CX Basic pKa: ┄CX LogP: 2.35CX LogD: 2.35Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.59Np Likeness Score: 2.35
References 1. Li H, Xu D, Sun W, Yang B, Li F, Liu M, Wang J, Xue Y, Hu Z, Zhang Y.. (2019) HPLC-DAD-Directed Isolation of Linearly Fused Prenylated Indole Alkaloids from a Soil-Derived Aspergillus versicolor ., 82 (8): [PMID:31390200 ] [10.1021/acs.jnatprod.9b00183 ]