The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-(Phenylsulfonamidomethyl)phenyl)carbamoyl)phenyl diethylcarbamate ID: ALA4560850
PubChem CID: 155558191
Max Phase: Preclinical
Molecular Formula: C25H27N3O5S
Molecular Weight: 481.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)C(=O)Oc1ccc(C(=O)Nc2ccc(CNS(=O)(=O)c3ccccc3)cc2)cc1
Standard InChI: InChI=1S/C25H27N3O5S/c1-3-28(4-2)25(30)33-22-16-12-20(13-17-22)24(29)27-21-14-10-19(11-15-21)18-26-34(31,32)23-8-6-5-7-9-23/h5-17,26H,3-4,18H2,1-2H3,(H,27,29)
Standard InChI Key: PXTLHPAPEPIJRE-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
2.5424 -7.6519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9551 -8.3618 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.3635 -7.6494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6162 -9.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6151 -10.8156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3231 -11.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0328 -10.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0300 -9.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3213 -9.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9084 -9.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2008 -9.9964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7411 -11.2227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4482 -10.8130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1566 -11.2204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4469 -9.9958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1578 -12.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8636 -10.8107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5720 -11.2182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8662 -12.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9082 -8.7705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4930 -9.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4965 -8.7702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7895 -8.3619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0809 -8.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0837 -9.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7913 -9.9968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3725 -8.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6655 -8.7729 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2501 -8.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5431 -8.3644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8365 -8.7735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8373 -9.5915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5507 -9.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2543 -9.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
4 10 1 0
10 11 1 0
7 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
14 17 1 0
17 18 1 0
16 19 1 0
10 20 2 0
11 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
28 2 1 0
2 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.57Molecular Weight (Monoisotopic): 481.1671AlogP: 4.26#Rotatable Bonds: 9Polar Surface Area: 104.81Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.60CX Basic pKa: ┄CX LogP: 4.05CX LogD: 4.05Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.48Np Likeness Score: -1.50
References 1. Summer SL, Kell SA, Zhu Z, Moore R, Liotta DC, Myers SJ, Koszalka GW, Traynelis SF, Menaldino DS.. (2019) Di-aryl Sulfonamide Motif Adds π-Stacking Bulk in Negative Allosteric Modulators of the NMDA Receptor., 10 (3): [PMID:30891121 ] [10.1021/acsmedchemlett.8b00395 ]