The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1,1-Dioxidothiomorpholino)phenyl 4-(4-cyanophenyl)piperidine-1-carboxylate ID: ALA4560889
PubChem CID: 155558440
Max Phase: Preclinical
Molecular Formula: C23H25N3O4S
Molecular Weight: 439.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(C2CCN(C(=O)Oc3cccc(N4CCS(=O)(=O)CC4)c3)CC2)cc1
Standard InChI: InChI=1S/C23H25N3O4S/c24-17-18-4-6-19(7-5-18)20-8-10-26(11-9-20)23(27)30-22-3-1-2-21(16-22)25-12-14-31(28,29)15-13-25/h1-7,16,20H,8-15H2
Standard InChI Key: NPDPAPDUJGLWAX-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
30.0132 -11.6058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1960 -11.6058 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.6046 -12.3135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6617 -9.5628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6605 -10.3823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3686 -10.7913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0783 -10.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0754 -9.5592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3668 -9.1539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7866 -10.7893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.9525 -10.7903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2451 -10.3812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2458 -9.5640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.5371 -10.7892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7836 -11.6066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4879 -12.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1981 -10.7897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4893 -10.3778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8325 -10.3748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1266 -10.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1217 -11.5969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8289 -12.0082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5410 -11.6020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4131 -12.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7070 -11.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9979 -11.9922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9937 -12.8103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7045 -13.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4107 -12.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2836 -13.2187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5788 -13.6250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
5 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
10 15 1 0
10 18 1 0
15 16 1 0
16 2 1 0
2 17 1 0
17 18 1 0
14 19 1 0
14 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
21 24 1 0
30 31 3 0
27 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.54Molecular Weight (Monoisotopic): 439.1566AlogP: 3.17#Rotatable Bonds: 3Polar Surface Area: 90.71Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.68CX LogP: 2.59CX LogD: 2.59Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.73Np Likeness Score: -1.55
References 1. Lamani M, Malamas MS, Farah SI, Shukla VG, Almeida MF, Weerts CM, Anderson J, Wood JT, Farizatto KLG, Bahr BA, Makriyannis A.. (2019) Piperidine and piperazine inhibitors of fatty acid amide hydrolase targeting excitotoxic pathology., 27 (23): [PMID:31629610 ] [10.1016/j.bmc.2019.115096 ]