benzyl (2S)-5-hydroxy-1-((S)-1-methoxy-3-phenylpropan-2-ylamino)-1-oxododecan-2-ylcarbamate

ID: ALA4560982

PubChem CID: 155558555

Max Phase: Preclinical

Molecular Formula: C30H44N2O5

Molecular Weight: 512.69

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCC(O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@H](COC)Cc1ccccc1

Standard InChI:  InChI=1S/C30H44N2O5/c1-3-4-5-6-13-18-27(33)19-20-28(32-30(35)37-22-25-16-11-8-12-17-25)29(34)31-26(23-36-2)21-24-14-9-7-10-15-24/h7-12,14-17,26-28,33H,3-6,13,18-23H2,1-2H3,(H,31,34)(H,32,35)/t26-,27?,28-/m0/s1

Standard InChI Key:  NMGWIUGWQXRWAJ-HSJPWVCISA-N

Molfile:  

 
     RDKit          2D

 37 38  0  0  0  0  0  0  0  0999 V2000
   26.1851  -15.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8969  -15.8940    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1851  -14.6599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6088  -15.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3206  -15.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0324  -15.4812    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3206  -16.7153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.7443  -15.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6088  -14.6599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3206  -14.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3206  -13.4300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0324  -13.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0324  -12.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7443  -11.7874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7443  -10.9578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4561  -10.5533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1638  -10.9578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8756  -10.5533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6125  -13.0221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4770  -15.8892    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4763  -16.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7682  -17.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0641  -16.7030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3565  -17.1102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3553  -17.9283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0676  -18.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7723  -17.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7428  -16.7111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4527  -15.4867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4542  -14.6695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.1627  -14.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4497  -17.1210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4464  -17.9380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1526  -18.3478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8620  -17.9405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8609  -17.1190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1542  -16.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  6  8  1  0
  4  9  1  1
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 11 19  1  0
  1 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  8 28  1  6
  8 29  1  0
 29 30  1  0
 30 31  1  0
 28 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4560982

    ---

Associated Targets(non-human)

Mboat4 Ghrelin O-acyltransferase (37 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.69Molecular Weight (Monoisotopic): 512.3250AlogP: 5.16#Rotatable Bonds: 18
Polar Surface Area: 96.89Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.53CX Basic pKa: CX LogP: 5.72CX LogD: 5.72
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: 0.28

References

1.  (2012)  Small molecule inhibitors of ghrelin O-acyltransferase, 

Source