The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
benzyl (2S)-5-hydroxy-1-((S)-1-methoxy-3-phenylpropan-2-ylamino)-1-oxododecan-2-ylcarbamate ID: ALA4560982
PubChem CID: 155558555
Max Phase: Preclinical
Molecular Formula: C30H44N2O5
Molecular Weight: 512.69
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC(O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@H](COC)Cc1ccccc1
Standard InChI: InChI=1S/C30H44N2O5/c1-3-4-5-6-13-18-27(33)19-20-28(32-30(35)37-22-25-16-11-8-12-17-25)29(34)31-26(23-36-2)21-24-14-9-7-10-15-24/h7-12,14-17,26-28,33H,3-6,13,18-23H2,1-2H3,(H,31,34)(H,32,35)/t26-,27?,28-/m0/s1
Standard InChI Key: NMGWIUGWQXRWAJ-HSJPWVCISA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
26.1851 -15.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8969 -15.8940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1851 -14.6599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6088 -15.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3206 -15.8940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0324 -15.4812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3206 -16.7153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7443 -15.8940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6088 -14.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3206 -14.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3206 -13.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0324 -13.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0324 -12.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7443 -11.7874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7443 -10.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4561 -10.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1638 -10.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8756 -10.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6125 -13.0221 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4770 -15.8892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4763 -16.7064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7682 -17.1143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0641 -16.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3565 -17.1102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3553 -17.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0676 -18.3374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7723 -17.9278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7428 -16.7111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4527 -15.4867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4542 -14.6695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.1627 -14.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4497 -17.1210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4464 -17.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1526 -18.3478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8620 -17.9405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8609 -17.1190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1542 -16.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
5 7 2 0
6 8 1 0
4 9 1 1
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
11 19 1 0
1 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
8 28 1 6
8 29 1 0
29 30 1 0
30 31 1 0
28 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.69Molecular Weight (Monoisotopic): 512.3250AlogP: 5.16#Rotatable Bonds: 18Polar Surface Area: 96.89Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.53CX Basic pKa: ┄CX LogP: 5.72CX LogD: 5.72Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: 0.28
References 1. (2012) Small molecule inhibitors of ghrelin O-acyltransferase,