(R)-4-((1S,2S,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]octan-2-yl)-hydroxymethyl-6-propoxyquinoline

ID: ALA4561002

PubChem CID: 155558597

Max Phase: Preclinical

Molecular Formula: C22H30N2O2

Molecular Weight: 354.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCOc1ccc2nccc([C@@H](O)[C@@H]3C[C@@H]4CC[N@@]3C[C@@H]4CC)c2c1

Standard InChI:  InChI=1S/C22H30N2O2/c1-3-11-26-17-5-6-20-19(13-17)18(7-9-23-20)22(25)21-12-16-8-10-24(21)14-15(16)4-2/h5-7,9,13,15-16,21-22,25H,3-4,8,10-12,14H2,1-2H3/t15-,16-,21-,22+/m0/s1

Standard InChI Key:  OEZPJPMWUSVADU-WWLNLUSPSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    9.3004  -19.4134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4380  -19.6457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7331  -20.8895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7247  -20.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0199  -21.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4380  -18.8994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5699  -18.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2630  -18.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4123  -17.8005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9846  -19.8365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0240  -22.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7372  -22.5398    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2984  -20.8978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3874  -16.9754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9225  -19.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2984  -22.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0115  -19.6498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5934  -21.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4505  -22.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5852  -22.1335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4505  -21.2959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8721  -20.8978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6453  -20.4377    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5375  -18.2441    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0857  -16.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1672  -21.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4502  -20.9193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7455  -21.3404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4  2  1  0
  5  3  1  0
  6  2  1  0
  8 15  1  0
  9  7  1  0
 10  1  1  0
 11  5  1  0
 12 19  2  0
 13  5  2  0
  9 14  1  1
 15 10  1  0
 16 11  2  0
  4 17  1  1
 18 13  1  0
 19 21  1  0
 20 18  2  0
 21  3  2  0
 22 18  1  0
  2 23  1  1
  8 24  1  6
  9  8  1  0
  8  6  1  0
 12 11  1  0
 16 20  1  0
 14 25  1  0
 22 26  1  0
 26 27  1  0
 27 28  1  0
  1  7  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4561002

    ---

Associated Targets(Human)

HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Streptococcus pneumoniae (31063 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 354.49Molecular Weight (Monoisotopic): 354.2307AlogP: 4.18#Rotatable Bonds: 6
Polar Surface Area: 45.59Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.89CX Basic pKa: 9.18CX LogP: 3.70CX LogD: 1.92
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.85Np Likeness Score: 0.37

References

1. Wang X, Zeng Y, Sheng L, Larson P, Liu X, Zou X, Wang S, Guo K, Ma C, Zhang G, Cui H, Ferguson DM, Li Y, Zhang J, Aldrich CC..  (2019)  A Cinchona Alkaloid Antibiotic That Appears To Target ATP Synthase in Streptococcus pneumoniae.,  62  (5): [PMID:30779564] [10.1021/acs.jmedchem.8b01353]

Source