The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-((1S,2S,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]octan-2-yl)-hydroxymethyl-6-propoxyquinoline ID: ALA4561002
PubChem CID: 155558597
Max Phase: Preclinical
Molecular Formula: C22H30N2O2
Molecular Weight: 354.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCOc1ccc2nccc([C@@H](O)[C@@H]3C[C@@H]4CC[N@@]3C[C@@H]4CC)c2c1
Standard InChI: InChI=1S/C22H30N2O2/c1-3-11-26-17-5-6-20-19(13-17)18(7-9-23-20)22(25)21-12-16-8-10-24(21)14-15(16)4-2/h5-7,9,13,15-16,21-22,25H,3-4,8,10-12,14H2,1-2H3/t15-,16-,21-,22+/m0/s1
Standard InChI Key: OEZPJPMWUSVADU-WWLNLUSPSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
9.3004 -19.4134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4380 -19.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7331 -20.8895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7247 -20.0645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0199 -21.3001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4380 -18.8994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5699 -18.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2630 -18.6631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4123 -17.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9846 -19.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0240 -22.1252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7372 -22.5398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2984 -20.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3874 -16.9754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9225 -19.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2984 -22.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0115 -19.6498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5934 -21.3001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4505 -22.1252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5852 -22.1335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4505 -21.2959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8721 -20.8978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6453 -20.4377 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5375 -18.2441 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.0857 -16.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1672 -21.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4502 -20.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7455 -21.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 4 1 0
4 2 1 0
5 3 1 0
6 2 1 0
8 15 1 0
9 7 1 0
10 1 1 0
11 5 1 0
12 19 2 0
13 5 2 0
9 14 1 1
15 10 1 0
16 11 2 0
4 17 1 1
18 13 1 0
19 21 1 0
20 18 2 0
21 3 2 0
22 18 1 0
2 23 1 1
8 24 1 6
9 8 1 0
8 6 1 0
12 11 1 0
16 20 1 0
14 25 1 0
22 26 1 0
26 27 1 0
27 28 1 0
1 7 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 354.49Molecular Weight (Monoisotopic): 354.2307AlogP: 4.18#Rotatable Bonds: 6Polar Surface Area: 45.59Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.89CX Basic pKa: 9.18CX LogP: 3.70CX LogD: 1.92Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.85Np Likeness Score: 0.37
References 1. Wang X, Zeng Y, Sheng L, Larson P, Liu X, Zou X, Wang S, Guo K, Ma C, Zhang G, Cui H, Ferguson DM, Li Y, Zhang J, Aldrich CC.. (2019) A Cinchona Alkaloid Antibiotic That Appears To Target ATP Synthase in Streptococcus pneumoniae., 62 (5): [PMID:30779564 ] [10.1021/acs.jmedchem.8b01353 ]