The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2,6-dichlorophenyl)-5-(2-(6-methylquinazolin-4-yloxy)phenyl)penta-1,4-dien-3-one ID: ALA4561010
PubChem CID: 129858256
Max Phase: Preclinical
Molecular Formula: C26H18Cl2N2O2
Molecular Weight: 461.35
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2ncnc(Oc3ccccc3/C=C/C(=O)/C=C/c3c(Cl)cccc3Cl)c2c1
Standard InChI: InChI=1S/C26H18Cl2N2O2/c1-17-9-14-24-21(15-17)26(30-16-29-24)32-25-8-3-2-5-18(25)10-11-19(31)12-13-20-22(27)6-4-7-23(20)28/h2-16H,1H3/b11-10+,13-12+
Standard InChI Key: PMSIPPVNSKUMCH-AQASXUMVSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
4.3941 -19.9840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3929 -20.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1010 -21.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0992 -19.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8078 -19.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8086 -20.7994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5171 -21.2065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2254 -20.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2206 -19.9735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5115 -19.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5072 -18.7530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2127 -18.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9180 -18.7489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6231 -18.3372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6192 -17.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9043 -17.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2022 -17.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9196 -19.5661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6280 -19.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6296 -20.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3381 -21.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9227 -21.2004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3396 -22.0149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0481 -22.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0445 -23.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7521 -23.6446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4600 -23.2346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4558 -22.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7476 -22.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3362 -23.6449 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.7415 -21.1925 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.6863 -19.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
13 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
25 30 1 0
29 31 1 0
1 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.35Molecular Weight (Monoisotopic): 460.0745AlogP: 7.33#Rotatable Bonds: 6Polar Surface Area: 52.08Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.25CX LogP: 8.09CX LogD: 8.09Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.28Np Likeness Score: -0.84
References 1. Rodrigues FC, Anil Kumar NV, Thakur G.. (2019) Developments in the anticancer activity of structurally modified curcumin: An up-to-date review., 177 [PMID:31129455 ] [10.1016/j.ejmech.2019.04.058 ]