The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((2-Acrylamidophenyl)amino)-N-(3-chloro-5-methylphenyl)-2-((4-(4-methylpiperazin-1-yl)phenyl)amino)pyrimidine-5-carboxamide ID: ALA4561015
PubChem CID: 155415524
Max Phase: Preclinical
Molecular Formula: C32H33ClN8O2
Molecular Weight: 597.12
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1ccccc1Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1C(=O)Nc1cc(C)cc(Cl)c1
Standard InChI: InChI=1S/C32H33ClN8O2/c1-4-29(42)37-27-7-5-6-8-28(27)38-30-26(31(43)35-24-18-21(2)17-22(33)19-24)20-34-32(39-30)36-23-9-11-25(12-10-23)41-15-13-40(3)14-16-41/h4-12,17-20H,1,13-16H2,2-3H3,(H,35,43)(H,37,42)(H2,34,36,38,39)
Standard InChI Key: WWIXYVANFPGPFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
15.6944 -14.7053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6933 -15.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4013 -15.9338 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1110 -15.5243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1082 -14.7017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3995 -14.2964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9853 -15.9328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8193 -15.9318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9846 -16.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8206 -16.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2765 -17.1565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2755 -17.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9834 -18.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6938 -17.9705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6913 -17.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1123 -17.1572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1132 -17.9736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8221 -18.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5315 -17.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5271 -17.1527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9838 -19.2001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2737 -19.6058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2722 -20.4195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9783 -20.8315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6876 -20.4238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6908 -19.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9756 -21.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2327 -16.7406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9425 -17.1457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6481 -16.7337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3579 -17.1388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9465 -17.9629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8143 -14.2904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5236 -14.6963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8113 -13.4732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5174 -13.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2219 -13.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9276 -13.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9250 -12.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2107 -11.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5080 -12.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2048 -11.0199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6367 -13.4671 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
4 8 1 0
7 9 1 0
8 10 1 0
9 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 9 1 0
10 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 10 1 0
13 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
20 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
29 32 2 0
5 33 1 0
33 34 2 0
33 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
40 42 1 0
38 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.12Molecular Weight (Monoisotopic): 596.2415AlogP: 6.05#Rotatable Bonds: 9Polar Surface Area: 114.52Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.95CX Basic pKa: 7.96CX LogP: 7.66CX LogD: 7.00Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.17Np Likeness Score: -1.53
References 1. Du G, Rao S, Gurbani D, Henning NJ, Jiang J, Che J, Yang A, Ficarro SB, Marto JA, Aguirre AJ, Sorger PK, Westover KD, Zhang T, Gray NS.. (2020) Structure-Based Design of a Potent and Selective Covalent Inhibitor for SRC Kinase That Targets a P-Loop Cysteine., 63 (4): [PMID:31935084 ] [10.1021/acs.jmedchem.9b01502 ]