(6-((4-tert-Butylbenzyl)(2-fluorophenylsulfonyl)aminomethyl)-pyridin-2-ylamino)acetic Acid Hydrochloride

ID: ALA4561017

PubChem CID: 70815856

Max Phase: Preclinical

Molecular Formula: C25H29ClFN3O4S

Molecular Weight: 485.58

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)c1ccc(CN(Cc2cccc(NCC(=O)O)n2)S(=O)(=O)c2ccccc2F)cc1.Cl

Standard InChI:  InChI=1S/C25H28FN3O4S.ClH/c1-25(2,3)19-13-11-18(12-14-19)16-29(34(32,33)22-9-5-4-8-21(22)26)17-20-7-6-10-23(28-20)27-15-24(30)31;/h4-14H,15-17H2,1-3H3,(H,27,28)(H,30,31);1H

Standard InChI Key:  XIMQEAUQJNVKAC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
   34.3259  -19.7116    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   32.8585  -22.0668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0335  -22.0668    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.4460  -22.7813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8945  -22.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8934  -23.3150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6082  -23.7278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3247  -23.3145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3219  -22.4840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6065  -22.0749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0317  -21.2438    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7445  -20.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3156  -20.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3125  -20.0090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4606  -21.2384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0272  -19.5957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.5927  -18.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5989  -19.6034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4589  -22.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1741  -22.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8879  -22.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8822  -21.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1664  -20.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6045  -22.4671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6088  -23.2921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3169  -22.0510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3169  -22.8793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3079  -18.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0215  -18.7692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7336  -18.3527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.4504  -18.7613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1626  -18.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8794  -18.7535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.1581  -17.5199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6040  -21.2499    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  9  3  1  0
  3 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 12 15  1  0
 14 16  2  0
 16 29  1  0
 28 17  1  0
 17 18  2  0
 18 14  1  0
 15 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 15  1  0
 21 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
 10 35  1  0
M  END

Associated Targets(Human)

PTGER2 Tclin Prostanoid EP2 receptor (1730 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.58Molecular Weight (Monoisotopic): 485.1785AlogP: 4.41#Rotatable Bonds: 9
Polar Surface Area: 99.60Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.05CX Basic pKa: 5.67CX LogP: 2.56CX LogD: 1.24
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -1.71

References

1. Iwamura R, Tanaka M, Okanari E, Kirihara T, Odani-Kawabata N, Shams N, Yoneda K..  (2018)  Identification of a Selective, Non-Prostanoid EP2 Receptor Agonist for the Treatment of Glaucoma: Omidenepag and its Prodrug Omidenepag Isopropyl.,  61  (15): [PMID:29995405] [10.1021/acs.jmedchem.8b00808]

Source