The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2'-(1H-Benzo[d]imidazole-2-yl)-3'-chloro-4-((1-phenylbutyl)carbamoyl)[1,1'-biphenyl]-2-carboxylic Acid ID: ALA4561041
PubChem CID: 155558340
Max Phase: Preclinical
Molecular Formula: C31H26ClN3O3
Molecular Weight: 524.02
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC[C@@H](NC(=O)c1ccc(-c2cccc(Cl)c2-c2nc3ccccc3[nH]2)c(C(=O)O)c1)c1ccccc1
Standard InChI: InChI=1S/C31H26ClN3O3/c1-2-9-25(19-10-4-3-5-11-19)35-30(36)20-16-17-21(23(18-20)31(37)38)22-12-8-13-24(32)28(22)29-33-26-14-6-7-15-27(26)34-29/h3-8,10-18,25H,2,9H2,1H3,(H,33,34)(H,35,36)(H,37,38)/t25-/m1/s1
Standard InChI Key: ZKKMYACBBTWSLG-RUZDIDTESA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
22.1659 -26.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1648 -27.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8770 -28.0554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5907 -27.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5879 -26.8192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8752 -26.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4602 -26.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4613 -25.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7502 -25.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0375 -25.5885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0403 -26.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7520 -26.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3250 -25.1810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3238 -24.3597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1694 -25.1800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8809 -25.5891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1700 -24.3587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4568 -28.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6138 -25.5907 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9014 -25.1832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9001 -24.3619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1902 -25.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4777 -25.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7706 -25.5951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6111 -23.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6102 -23.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8972 -22.7228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1837 -23.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1881 -23.9561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7090 -27.7249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3692 -28.8745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5657 -29.0439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1601 -28.3345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3407 -28.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9259 -29.0383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3406 -29.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1587 -29.7515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8768 -28.8768 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
1 7 1 0
10 13 1 0
13 14 2 0
8 15 1 0
15 16 1 0
15 17 2 0
2 18 1 0
13 19 1 0
19 20 1 0
20 21 1 6
20 22 1 0
22 23 1 0
23 24 1 0
21 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 21 1 0
18 30 2 0
30 33 1 0
32 31 1 0
31 18 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
3 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.02Molecular Weight (Monoisotopic): 523.1663AlogP: 7.52#Rotatable Bonds: 8Polar Surface Area: 95.08Molecular Species: ACIDHBA: 3HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.43CX Basic pKa: 4.86CX LogP: 6.07CX LogD: 4.04Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.20Np Likeness Score: -0.82
References 1. Su S, Clarke A, Han Y, Chao HJ, Bostwick J, Schumacher W, Wang T, Yan M, Hsu MY, Simmons E, Luk C, Xu C, Dabros M, Galella M, Onorato J, Gordon D, Wexler R, Gargalovic PS, Lawrence RM.. (2019) Biphenyl Acid Derivatives as APJ Receptor Agonists., 62 (22): [PMID:31724863 ] [10.1021/acs.jmedchem.9b01513 ]