The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-(1H-1,2,4-triazol-1-yl)-5-(trifluoromethoxy)phenyl)-6-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazine ID: ALA4561060
PubChem CID: 155558415
Max Phase: Preclinical
Molecular Formula: C22H16F3N7O3
Molecular Weight: 483.41
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccc3nnc(-c4cc(OC(F)(F)F)ccc4-n4cncn4)n3n2)cc1OC
Standard InChI: InChI=1S/C22H16F3N7O3/c1-33-18-7-3-13(9-19(18)34-2)16-5-8-20-28-29-21(32(20)30-16)15-10-14(35-22(23,24)25)4-6-17(15)31-12-26-11-27-31/h3-12H,1-2H3
Standard InChI Key: RDFVJEQVWJEORI-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
27.4903 -14.2115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4892 -15.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1972 -15.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9069 -15.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9041 -14.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1954 -13.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6102 -13.7966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3195 -14.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1930 -12.9854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8995 -12.5747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9592 -18.6547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7764 -18.6547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7091 -17.8780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5842 -16.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5831 -17.4709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2911 -17.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0008 -17.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9979 -16.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2893 -16.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2909 -18.6971 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6332 -19.1757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8855 -19.9530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7028 -19.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9553 -19.1760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2869 -15.4254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5779 -15.0189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5755 -14.2017 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.8715 -15.4296 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.8678 -14.6063 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.3678 -17.3958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0264 -17.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7696 -17.5514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8605 -16.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2020 -16.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4525 -16.5859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
6 9 1 0
9 10 1 0
11 12 1 0
12 31 2 0
30 13 1 0
13 11 2 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
16 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 20 1 0
19 25 1 0
25 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
17 13 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
34 3 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.41Molecular Weight (Monoisotopic): 483.1267AlogP: 3.95#Rotatable Bonds: 6Polar Surface Area: 101.48Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.63CX LogP: 4.27CX LogD: 4.27Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.83
References 1. Reed CW, Washecheck JP, Quitlag MC, Jenkins MT, Rodriguez AL, Engers DW, Blobaum AL, Conn PJ, Niswender CM, Lindsley CW.. (2019) Surveying heterocycles as amide bioisosteres within a series of mGlu7 NAMs: Discovery of VU6019278., 29 (10): [PMID:30910459 ] [10.1016/j.bmcl.2019.03.016 ]