3-hydroxybenzene 1,2,4-trisphosphate

ID: ALA4561065

PubChem CID: 122513607

Max Phase: Preclinical

Molecular Formula: C6H9O13P3

Molecular Weight: 382.05

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=P(O)(O)Oc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1O

Standard InChI:  InChI=1S/C6H9O13P3/c7-5-3(17-20(8,9)10)1-2-4(18-21(11,12)13)6(5)19-22(14,15)16/h1-2,7H,(H2,8,9,10)(H2,11,12,13)(H2,14,15,16)

Standard InChI Key:  DNRVRTXMAGBWEP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 22  0  0  0  0  0  0  0  0999 V2000
   12.1004  -10.6744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9278   -9.8534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6861  -10.6740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5064   -7.4001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3911   -9.4531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2185   -9.4465    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   12.7998   -6.9963    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   13.2122   -6.2740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8101   -8.7267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6309   -8.7283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7894  -11.7873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3895  -11.0842    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   12.8077   -9.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5134   -9.8557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1006   -9.8577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0987   -8.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3922   -8.6340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0963   -7.4044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3914   -6.2766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8049   -8.6304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9766  -11.7847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5122   -8.2212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 17  5  2  0
 16 18  1  0
 18  7  1  0
 13 14  1  0
 12 11  1  0
 20 16  2  0
 15  1  1  0
  1 12  1  0
  7  4  2  0
 13 20  1  0
  5 15  1  0
 15 13  2  0
 16 17  1  0
 21 12  1  0
  7 19  1  0
 10  6  1  0
 12  3  2  0
  6  9  1  0
  6  2  2  0
  8  7  1  0
 14  6  1  0
 20 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4561065

    ---

Associated Targets(Human)

INPPL1 Tchem Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 (180 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 382.05Molecular Weight (Monoisotopic): 381.9256AlogP: -0.19#Rotatable Bonds: 6
Polar Surface Area: 220.51Molecular Species: ACIDHBA: 7HBD: 7
#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.31CX Basic pKa: CX LogP: -0.55CX LogD: -9.83
Aromatic Rings: 1Heavy Atoms: 22QED Weighted: 0.32Np Likeness Score: 0.92

References

1. White G, Prior C, Mills SJ, Baker K, Whitfield H, Riley AM, Oganesyan VS, Potter BVL, Brearley CA..  (2020)  Regioisomeric Family of Novel Fluorescent Substrates for SHIP2.,  11  (3): [PMID:32184962] [10.1021/acsmedchemlett.9b00368]

Source