The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2'-((7-(4-(Pyridin-3-yl)-1H-1,2,3-triazol-1-yl)heptyl)carbamoyl)-[1,1'-biphenyl]-3-carboxylic acid ID: ALA4561248
PubChem CID: 117679755
Max Phase: Preclinical
Molecular Formula: C28H29N5O3
Molecular Weight: 483.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cccc(-c2ccccc2C(=O)NCCCCCCCn2cc(-c3cccnc3)nn2)c1
Standard InChI: InChI=1S/C28H29N5O3/c34-27(25-14-5-4-13-24(25)21-10-8-11-22(18-21)28(35)36)30-16-6-2-1-3-7-17-33-20-26(31-32-33)23-12-9-15-29-19-23/h4-5,8-15,18-20H,1-3,6-7,16-17H2,(H,30,34)(H,35,36)
Standard InChI Key: RISXIPGADPIRON-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
18.9315 -15.5900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7470 -15.5911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1539 -14.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7465 -14.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9280 -14.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5247 -14.8884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9742 -14.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4544 -15.5449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2317 -15.2925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2319 -14.4753 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4547 -14.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9350 -14.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6461 -14.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3504 -14.0497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0615 -14.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7657 -14.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4768 -14.4405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1811 -14.0261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8922 -14.4287 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5965 -14.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3076 -14.4169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5897 -13.1971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3115 -15.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0218 -15.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7270 -15.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7175 -14.4014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0067 -14.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9954 -13.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6998 -12.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6905 -11.9556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9774 -11.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2723 -11.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2851 -12.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3935 -11.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1058 -11.9395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3842 -10.7219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 7 2 0
3 7 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
27 28 1 0
30 34 1 0
34 35 1 0
34 36 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.57Molecular Weight (Monoisotopic): 483.2270AlogP: 5.09#Rotatable Bonds: 12Polar Surface Area: 110.00Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.73CX Basic pKa: 4.34CX LogP: 4.36CX LogD: 1.78Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.27Np Likeness Score: -1.28
References 1. Travelli C, Aprile S, Mattoteia D, Colombo G, Clemente N, Scanziani E, Terrazzino S, Alisi MA, Polenzani L, Grosa G, Genazzani AA, Tron GC, Galli U.. (2019) Identification of potent triazolylpyridine nicotinamide phosphoribosyltransferase (NAMPT) inhibitors bearing a 1,2,3-triazole tail group., 181 [PMID:31400709 ] [10.1016/j.ejmech.2019.111576 ]