The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Ethyl-1-{4-[4-(2-methanesulfonylpropan-2-yl)-6-{(1R,6S)-3-oxabicyclo[4.1.0]heptan-6-yl}pyrimidin-2-yl]phenyl}urea ID: ALA4561361
PubChem CID: 155558737
Max Phase: Preclinical
Molecular Formula: C23H30N4O4S
Molecular Weight: 458.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCNC(=O)Nc1ccc(-c2nc(C(C)(C)S(C)(=O)=O)cc([C@@]34CCOC[C@@H]3C4)n2)cc1
Standard InChI: InChI=1S/C23H30N4O4S/c1-5-24-21(28)25-17-8-6-15(7-9-17)20-26-18(22(2,3)32(4,29)30)12-19(27-20)23-10-11-31-14-16(23)13-23/h6-9,12,16H,5,10-11,13-14H2,1-4H3,(H2,24,25,28)/t16-,23+/m0/s1
Standard InChI Key: NWPWUFFZHOWRDZ-QMHKHESXSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
17.9241 -29.8653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5159 -29.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1030 -29.8627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3868 -28.0237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8034 -28.7403 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.2157 -28.0213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2353 -27.9154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2341 -28.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9489 -29.1555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6652 -28.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6624 -27.9117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9471 -27.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6576 -25.4486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9437 -25.0344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2287 -25.4478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2275 -26.2754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3768 -29.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3767 -29.9789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0910 -30.3902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8058 -29.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8018 -29.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0870 -28.7397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6581 -26.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9418 -26.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6599 -27.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3699 -26.6821 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.0905 -29.1534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5214 -30.3869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2347 -29.9723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9503 -30.3828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6635 -29.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3792 -30.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2322 -29.1474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
24 16 1 0
23 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
24 12 1 1
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
10 17 1 0
24 23 1 0
25 24 1 0
23 25 1 0
23 26 1 1
8 2 1 0
2 5 1 0
5 27 1 0
20 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
29 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.58Molecular Weight (Monoisotopic): 458.1988AlogP: 3.24#Rotatable Bonds: 6Polar Surface Area: 110.28Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.05CX Basic pKa: 1.34CX LogP: 2.51CX LogD: 2.51Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.69Np Likeness Score: -0.98
References 1. Hobbs H, Bravi G, Campbell I, Convery M, Davies H, Inglis G, Pal S, Peace S, Redmond J, Summers D.. (2019) Discovery of 3-Oxabicyclo[4.1.0]heptane, a Non-nitrogen Containing Morpholine Isostere, and Its Application in Novel Inhibitors of the PI3K-AKT-mTOR Pathway., 62 (15): [PMID:31283227 ] [10.1021/acs.jmedchem.9b00348 ]