2-(3-(3-fluorobenzyloxy)benzoyl)-3-hydroxycyclohex-2-en-1-one

ID: ALA4561368

PubChem CID: 155558808

Max Phase: Preclinical

Molecular Formula: C20H17FO4

Molecular Weight: 340.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1CCCC(O)=C1C(=O)c1cccc(OCc2cccc(F)c2)c1

Standard InChI:  InChI=1S/C20H17FO4/c21-15-6-1-4-13(10-15)12-25-16-7-2-5-14(11-16)20(24)19-17(22)8-3-9-18(19)23/h1-2,4-7,10-11,22H,3,8-9,12H2

Standard InChI Key:  HBFXLNOFSCQGBV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    4.3569   -9.0510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3558   -9.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0638  -10.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7735   -9.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7707   -9.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0620   -8.6421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6491   -8.6425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6489   -7.8254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9415   -9.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2319   -8.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5264   -9.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5223   -9.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2300  -10.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9417   -9.8623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2352   -7.8186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6485  -10.2723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4768   -8.6361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1861   -9.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8922   -8.6308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5999   -9.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3056   -8.6295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3029   -7.8115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5887   -7.4057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8860   -7.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0146   -9.0358    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 10 15  1  0
 14 16  2  0
  5 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 21 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4561368

    ---

Associated Targets(Human)

HPD Tclin 4-hydroxyphenylpyruvate dioxygenase (117 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 340.35Molecular Weight (Monoisotopic): 340.1111AlogP: 4.15#Rotatable Bonds: 5
Polar Surface Area: 63.60Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.45CX Basic pKa: CX LogP: 3.71CX LogD: 0.86
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.66Np Likeness Score: -0.55

References

1. Ndikuryayo F, Kang WM, Wu FX, Yang WC, Yang GF..  (2019)  Hydrophobicity-oriented drug design (HODD) of new human 4-hydroxyphenylpyruvate dioxygenase inhibitors.,  166  [PMID:30684868] [10.1016/j.ejmech.2019.01.032]

Source