N-(4-((1-oxoisoindolin-2-yl)methyl)phenyl)-4-(pyridin-3-yl)piperidine-1-carboxamide

ID: ALA4561390

PubChem CID: 155558836

Max Phase: Preclinical

Molecular Formula: C26H26N4O2

Molecular Weight: 426.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(CN2Cc3ccccc3C2=O)cc1)N1CCC(c2cccnc2)CC1

Standard InChI:  InChI=1S/C26H26N4O2/c31-25-24-6-2-1-4-22(24)18-30(25)17-19-7-9-23(10-8-19)28-26(32)29-14-11-20(12-15-29)21-5-3-13-27-16-21/h1-10,13,16,20H,11-12,14-15,17-18H2,(H,28,32)

Standard InChI Key:  ASFNKAVEGSTFPN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    6.5774  -20.0119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2836  -19.5965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9970  -20.0065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2805  -18.7752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7073  -19.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4179  -20.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1277  -19.5867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1251  -18.7645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4067  -18.3588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6998  -18.7717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8348  -18.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5487  -18.7573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6417  -19.5725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3011  -18.4199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4670  -17.6156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8510  -19.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4471  -19.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8567  -20.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6741  -20.4354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0803  -19.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6643  -19.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8686  -19.5987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1604  -20.0106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1593  -20.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8725  -21.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5869  -20.8309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4512  -21.2386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7391  -20.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0277  -21.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0273  -22.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7441  -22.4710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4525  -22.0566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  3  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 17  1  0
 16 14  1  0
 14 12  1  0
 14 15  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  1 22  1  0
  1 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4561390

    ---

Associated Targets(Human)

COR-L23 (253 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A2780 (11979 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 426.52Molecular Weight (Monoisotopic): 426.2056AlogP: 4.65#Rotatable Bonds: 4
Polar Surface Area: 65.54Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.34CX Basic pKa: 4.91CX LogP: 3.15CX LogD: 3.15
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.66Np Likeness Score: -1.30

References

1. Palacios DS, Meredith EL, Kawanami T, Adams CM, Chen X, Darsigny V, Palermo M, Baird D, George EL, Guy C, Hewett J, Tierney L, Thigale S, Wang L, Weihofen WA..  (2019)  Scaffold Morphing Identifies 3-Pyridyl Azetidine Ureas as Inhibitors of Nicotinamide Phosphoribosyltransferase (NAMPT).,  10  (11): [PMID:31749905] [10.1021/acsmedchemlett.9b00325]

Source