The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(6-(2,6-Dichloro-3,5-dimethoxyphenyl)-1H-pyrazolo[3,4-b]pyridin-3-yl)-5-(4-methylpiperazin-1-yl)thiophene-2-carboxamide ID: ALA4561437
PubChem CID: 141462272
Max Phase: Preclinical
Molecular Formula: C24H24Cl2N6O3S
Molecular Weight: 547.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c(Cl)c(-c2ccc3c(NC(=O)c4ccc(N5CCN(C)CC5)s4)n[nH]c3n2)c1Cl
Standard InChI: InChI=1S/C24H24Cl2N6O3S/c1-31-8-10-32(11-9-31)18-7-6-17(36-18)24(33)28-23-13-4-5-14(27-22(13)29-30-23)19-20(25)15(34-2)12-16(35-3)21(19)26/h4-7,12H,8-11H2,1-3H3,(H2,27,28,29,30,33)
Standard InChI Key: IZQMEBTVEQLNOT-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
16.1014 -14.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9737 -14.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7055 -13.6459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2838 -14.2243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9116 -14.9519 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.5230 -15.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7777 -16.1799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7246 -15.2319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0899 -14.0966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3809 -13.3328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1911 -13.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7020 -13.8413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4110 -14.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6050 -14.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5122 -13.7137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6968 -13.3869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6968 -14.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9878 -14.6127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2787 -14.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2787 -13.3869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9878 -12.9783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9542 -13.7955 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4741 -13.1322 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4741 -14.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5737 -12.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8646 -13.3869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1596 -12.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1596 -12.1611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8646 -11.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5737 -12.1611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8646 -10.9353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1596 -10.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4506 -13.3869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7415 -12.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2787 -11.7525 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.8646 -14.2041 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
1 5 1 0
6 7 2 0
6 8 1 0
1 6 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
9 14 1 0
12 15 1 0
4 9 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
22 23 1 0
22 24 2 0
16 23 1 0
17 24 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
25 30 2 0
31 32 1 0
29 31 1 0
33 34 1 0
27 33 1 0
30 35 1 0
26 36 1 0
20 25 1 0
8 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.47Molecular Weight (Monoisotopic): 546.1008AlogP: 5.01#Rotatable Bonds: 6Polar Surface Area: 95.61Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.64CX Basic pKa: 7.13CX LogP: 5.09CX LogD: 4.86Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -1.20
References 1. Zhao B, Li Y, Xu P, Dai Y, Luo C, Sun Y, Ai J, Geng M, Duan W.. (2016) Discovery of Substituted 1H-Pyrazolo[3,4-b]pyridine Derivatives as Potent and Selective FGFR Kinase Inhibitors., 7 (6): [PMID:27326339 ] [10.1021/acsmedchemlett.6b00066 ]