The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,4:3,5-dibenzylidene-D-xylosediethyl dithioacetal ID: ALA456199
PubChem CID: 44588352
Max Phase: Preclinical
Molecular Formula: C23H28O4S2
Molecular Weight: 432.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCSC(SCC)[C@@H]1O[C@H](c2ccccc2)O[C@@H]2CO[C@H](c3ccccc3)O[C@@H]21
Standard InChI: InChI=1S/C23H28O4S2/c1-3-28-23(29-4-2)20-19-18(25-22(27-20)17-13-9-6-10-14-17)15-24-21(26-19)16-11-7-5-8-12-16/h5-14,18-23H,3-4,15H2,1-2H3/t18-,19+,20-,21+,22-/m1/s1
Standard InChI Key: LDBUJIGWHJRDNE-OQEHDIDLSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
7.1853 -2.7862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1853 -3.6114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8980 -4.0177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8980 -2.3675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8980 -1.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6132 -1.1277 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.1829 -1.1277 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.3282 -1.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0433 -1.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4678 -1.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7569 -1.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4718 -4.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7600 -3.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0459 -4.0229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0467 -4.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7674 -5.2624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4743 -4.8451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6107 -2.7862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6072 -3.6114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3166 -4.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0340 -3.6173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0375 -2.7923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3236 -2.3724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7530 -2.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4621 -2.8016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1788 -2.3914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1836 -1.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4657 -1.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7560 -1.5598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6033 -1.9570 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5992 -4.4323 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5 7 1 0
15 16 1 0
2 3 1 0
16 17 2 0
17 12 1 0
2 12 1 1
18 19 1 0
6 8 1 0
3 19 1 0
8 9 1 0
18 4 1 0
7 10 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
10 11 1 0
4 5 1 1
24 25 2 0
1 2 1 0
25 26 1 0
12 13 2 0
26 27 2 0
5 6 1 0
27 28 1 0
13 14 1 0
28 29 2 0
29 24 1 0
22 24 1 1
1 4 1 0
18 30 1 6
14 15 2 0
19 31 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.61Molecular Weight (Monoisotopic): 432.1429AlogP: 5.42#Rotatable Bonds: 7Polar Surface Area: 36.92Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.18CX LogD: 6.18Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.54Np Likeness Score: 0.30
References 1. Gruzman A, Shamni O, Ben Yakir M, Sandovski D, Elgart A, Alpert E, Cohen G, Hoffman A, Katzhendler Y, Cerasi E, Sasson S.. (2008) Novel D-xylose derivatives stimulate muscle glucose uptake by activating AMP-activated protein kinase alpha., 51 (24): [PMID:19049348 ] [10.1021/jm8008713 ]