The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5-(1,3-Diphenylpropan-2-yl)thiophene-2-carbonyl)-L-arginine ID: ALA4562412
PubChem CID: 155558856
Max Phase: Preclinical
Molecular Formula: C26H30N4O3S
Molecular Weight: 478.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@H](NC(=O)c1ccc(C(Cc2ccccc2)Cc2ccccc2)s1)C(=O)O
Standard InChI: InChI=1S/C26H30N4O3S/c27-26(28)29-15-7-12-21(25(32)33)30-24(31)23-14-13-22(34-23)20(16-18-8-3-1-4-9-18)17-19-10-5-2-6-11-19/h1-6,8-11,13-14,20-21H,7,12,15-17H2,(H,30,31)(H,32,33)(H4,27,28,29)/t21-/m0/s1
Standard InChI Key: FHANYSYADPRXLB-NRFANRHFSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
17.9631 -6.4045 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.7091 -6.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6047 -5.2327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7906 -5.0812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3965 -5.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4343 -6.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4538 -7.2708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1398 -6.0179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8650 -6.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5706 -5.9840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8845 -7.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1789 -7.6687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6097 -7.6348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5510 -5.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2525 -4.7270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2329 -3.9015 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9384 -3.4739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9189 -2.6486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6636 -3.8677 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5706 -5.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1625 -5.0871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1572 -6.5183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5778 -4.3783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3357 -6.5172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3989 -4.3852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8141 -3.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4078 -2.9621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5821 -2.9596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1706 -3.6682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9307 -5.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1100 -5.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6975 -6.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1118 -7.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9312 -7.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
2 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 1
9 11 1 0
11 12 1 0
11 13 2 0
10 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
5 20 1 0
20 21 1 0
20 22 1 0
21 23 1 0
22 24 1 0
23 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 23 1 0
24 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.62Molecular Weight (Monoisotopic): 478.2039AlogP: 3.76#Rotatable Bonds: 12Polar Surface Area: 128.30Molecular Species: ZWITTERIONHBA: 4HBD: 5#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.77CX Basic pKa: 11.99CX LogP: 2.99CX LogD: 2.99Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.15Np Likeness Score: -0.16
References 1. Rowley JA, Reid RC, Poon EKY, Wu KC, Lim J, Lohman RJ, Hamidon JK, Yau MK, Halili MA, Durek T, Iyer A, Fairlie DP.. (2020) Potent Thiophene Antagonists of Human Complement C3a Receptor with Anti-Inflammatory Activity., 63 (2): [PMID:31910011 ] [10.1021/acs.jmedchem.9b00927 ]