The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 2-(7-methoxy-1-(3,4,5-trimethoxyphenyl)-4,5-dihydro-2H-benzo[e]indazol-2-yl)acetate ID: ALA4562815
PubChem CID: 155559919
Max Phase: Preclinical
Molecular Formula: C25H28N2O6
Molecular Weight: 452.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)Cn1nc2c(c1-c1cc(OC)c(OC)c(OC)c1)-c1ccc(OC)cc1CC2
Standard InChI: InChI=1S/C25H28N2O6/c1-6-33-22(28)14-27-24(16-12-20(30-3)25(32-5)21(13-16)31-4)23-18-9-8-17(29-2)11-15(18)7-10-19(23)26-27/h8-9,11-13H,6-7,10,14H2,1-5H3
Standard InChI Key: LFVCDCCUKKNKSU-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
15.4757 -15.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4745 -16.3503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1867 -16.7634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9005 -16.3498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8977 -15.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1849 -15.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6057 -15.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4909 -14.1232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6881 -14.2963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9063 -14.8336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3537 -15.4410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9601 -15.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7094 -15.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4075 -16.3930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6057 -16.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0580 -16.8260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3068 -17.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1125 -17.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6608 -17.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7665 -16.7624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7679 -15.1182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7677 -14.2969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0550 -16.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1865 -17.5847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4746 -17.9931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3647 -18.5598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8177 -19.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0746 -13.7477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2456 -12.9436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6321 -12.3991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0259 -12.6881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7989 -11.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1854 -11.0464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 11 2 0
10 8 2 0
8 9 1 0
9 7 1 0
5 7 1 0
10 11 1 0
10 13 1 0
11 15 1 0
14 12 1 0
12 13 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
2 20 1 0
1 21 1 0
21 22 1 0
20 23 1 0
3 24 1 0
24 25 1 0
18 26 1 0
26 27 1 0
9 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
32 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.51Molecular Weight (Monoisotopic): 452.1947AlogP: 3.91#Rotatable Bonds: 8Polar Surface Area: 81.04Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.79CX LogP: 3.40CX LogD: 3.40Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -0.32
References 1. Jiang J, Zhang Q, Guo J, Fang S, Zhou R, Zhu J, Chen X, Zhou Y, Zheng C.. (2019) Synthesis and biological evaluation of 7-methoxy-1-(3,4,5-trimethoxyphenyl)-4,5-dihydro-2H-benzo[e]indazoles as new colchicine site inhibitors., 29 (18): [PMID:31362922 ] [10.1016/j.bmcl.2019.07.042 ]