ethyl 2-(7-methoxy-1-(3,4,5-trimethoxyphenyl)-4,5-dihydro-2H-benzo[e]indazol-2-yl)acetate

ID: ALA4562815

PubChem CID: 155559919

Max Phase: Preclinical

Molecular Formula: C25H28N2O6

Molecular Weight: 452.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)Cn1nc2c(c1-c1cc(OC)c(OC)c(OC)c1)-c1ccc(OC)cc1CC2

Standard InChI:  InChI=1S/C25H28N2O6/c1-6-33-22(28)14-27-24(16-12-20(30-3)25(32-5)21(13-16)31-4)23-18-9-8-17(29-2)11-15(18)7-10-19(23)26-27/h8-9,11-13H,6-7,10,14H2,1-5H3

Standard InChI Key:  LFVCDCCUKKNKSU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   15.4757  -15.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4745  -16.3503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1867  -16.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9005  -16.3498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8977  -15.5230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1849  -15.1177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6057  -15.1134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4909  -14.1232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6881  -14.2963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9063  -14.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3537  -15.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9601  -15.7856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7094  -15.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4075  -16.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6057  -16.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0580  -16.8260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3068  -17.6074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1125  -17.7784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6608  -17.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7665  -16.7624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7679  -15.1182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7677  -14.2969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0550  -16.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1865  -17.5847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4746  -17.9931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3647  -18.5598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8177  -19.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0746  -13.7477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2456  -12.9436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6321  -12.3991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0259  -12.6881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7989  -11.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1854  -11.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7 11  2  0
 10  8  2  0
  8  9  1  0
  9  7  1  0
  5  7  1  0
 10 11  1  0
 10 13  1  0
 11 15  1  0
 14 12  1  0
 12 13  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  2 20  1  0
  1 21  1  0
 21 22  1  0
 20 23  1  0
  3 24  1  0
 24 25  1  0
 18 26  1  0
 26 27  1  0
  9 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4562815

    ---

Associated Targets(Human)

COLO 205 (50209 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

TUBB2B Tubulin (2175 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.51Molecular Weight (Monoisotopic): 452.1947AlogP: 3.91#Rotatable Bonds: 8
Polar Surface Area: 81.04Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.79CX LogP: 3.40CX LogD: 3.40
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -0.32

References

1. Jiang J, Zhang Q, Guo J, Fang S, Zhou R, Zhu J, Chen X, Zhou Y, Zheng C..  (2019)  Synthesis and biological evaluation of 7-methoxy-1-(3,4,5-trimethoxyphenyl)-4,5-dihydro-2H-benzo[e]indazoles as new colchicine site inhibitors.,  29  (18): [PMID:31362922] [10.1016/j.bmcl.2019.07.042]

Source