The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(4-cyanobenzyl)-1-(2-((1-(1-methylpiperidin-4-yl)-1H-pyrazol-4-yl)amino)pyridin-4-yl)piperidine-3-carboxamide ID: ALA4563380
PubChem CID: 155559363
Max Phase: Preclinical
Molecular Formula: C28H34N8O
Molecular Weight: 498.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCC(n2cc(Nc3cc(N4CCC[C@H](C(=O)NCc5ccc(C#N)cc5)C4)ccn3)cn2)CC1
Standard InChI: InChI=1S/C28H34N8O/c1-34-13-9-25(10-14-34)36-20-24(18-32-36)33-27-15-26(8-11-30-27)35-12-2-3-23(19-35)28(37)31-17-22-6-4-21(16-29)5-7-22/h4-8,11,15,18,20,23,25H,2-3,9-10,12-14,17,19H2,1H3,(H,30,33)(H,31,37)/t23-/m0/s1
Standard InChI Key: MJCPTJYJJUIIGG-QHCPKHFHSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
34.8792 -3.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8792 -4.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5886 -4.5854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2980 -4.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2980 -3.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5886 -2.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5882 -5.4058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8747 -5.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8744 -6.6344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5867 -7.0479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3009 -6.6308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2978 -5.8116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0111 -2.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7217 -3.3596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0134 -2.1276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.4347 -2.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1454 -3.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1416 -4.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8473 -4.6008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5613 -4.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5611 -3.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8507 -2.9576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1623 -7.0468 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.4541 -6.6391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3651 -5.8300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5655 -5.6612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1579 -6.3695 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.7056 -6.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2322 -4.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7163 -4.2551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3862 -3.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5734 -3.4229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0918 -4.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4230 -4.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2429 -2.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2690 -4.5975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9764 -5.0066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
5 13 1 6
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
9 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 2 0
28 24 1 0
26 29 1 0
29 30 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
32 35 1 0
36 37 3 0
20 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.64Molecular Weight (Monoisotopic): 498.2856AlogP: 3.69#Rotatable Bonds: 7Polar Surface Area: 102.11Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.08CX LogP: 2.58CX LogD: 0.01Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.51Np Likeness Score: -1.81
References 1. Liu S, Jiang Y, Yan R, Li Z, Wan S, Zhang T, Wu X, Hou J, Zhu Z, Tian Y, Zhang J.. (2019) Design, synthesis and biological evaluations of 2-amino-4-(1-piperidine) pyridine derivatives as novel anti crizotinib-resistant ALK/ROS1 dual inhibitors., 179 [PMID:31260890 ] [10.1016/j.ejmech.2019.06.043 ]