The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(1-(3-(4-(dimethylamino)but-2-enamido)phenylsulfonyl)piperidin-4-yl)-4-(2-(2-methoxyphenyl)acetamido)-1H-pyrazole-3-carboxamide 2,2,2-trifluoroacetate ID: ALA4563705
PubChem CID: 155559297
Max Phase: Preclinical
Molecular Formula: C32H38F3N7O8S
Molecular Weight: 623.74
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1CC(=O)Nc1c[nH]nc1C(=O)NC1CCN(S(=O)(=O)c2cccc(NC(=O)/C=C/CN(C)C)c2)CC1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C30H37N7O6S.C2HF3O2/c1-36(2)15-7-12-27(38)32-23-9-6-10-24(19-23)44(41,42)37-16-13-22(14-17-37)33-30(40)29-25(20-31-35-29)34-28(39)18-21-8-4-5-11-26(21)43-3;3-2(4,5)1(6)7/h4-12,19-20,22H,13-18H2,1-3H3,(H,31,35)(H,32,38)(H,33,40)(H,34,39);(H,6,7)/b12-7+;
Standard InChI Key: HWYLKHCBJNVQSZ-RRAJOLSVSA-N
Molfile:
RDKit 2D
51 53 0 0 0 0 0 0 0 0999 V2000
42.1475 -16.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8552 -16.1539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4398 -16.1539 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
42.1475 -17.3797 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.4376 -16.9670 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
43.5629 -16.5625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.8552 -15.3368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4104 -16.4842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4145 -15.6670 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.7048 -16.0720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5196 -12.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3368 -12.8357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1110 -12.1280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9712 -12.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7454 -12.1302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5626 -12.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8131 -11.3501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1506 -10.8714 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4909 -11.3536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7884 -12.8357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5626 -13.5434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1970 -13.5434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7873 -14.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1924 -14.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0100 -14.9589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4207 -14.2514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0140 -13.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2331 -15.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6359 -16.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4523 -16.3867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8644 -15.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4541 -14.9684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6390 -14.9685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8579 -17.0962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6751 -17.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0806 -17.8091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0867 -16.3937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.8978 -17.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3034 -18.5221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1206 -18.5255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.5261 -19.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5322 -17.8196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1110 -13.5434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5196 -14.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1101 -14.9550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5180 -15.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3361 -15.6626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7445 -14.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3342 -14.2457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2929 -14.9534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8856 -14.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
1 5 1 0
2 6 1 0
2 7 2 0
9 8 2 0
10 9 2 0
11 12 1 0
11 13 2 0
12 15 1 0
16 14 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 15 2 0
14 20 1 0
14 21 2 0
20 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 9 1 0
9 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
30 34 1 0
34 35 1 0
35 36 1 0
35 37 2 0
36 38 2 0
38 39 1 0
39 40 1 0
40 41 1 0
40 42 1 0
11 43 1 0
43 44 1 0
44 45 2 0
45 46 1 0
46 47 2 0
47 48 1 0
48 49 2 0
49 44 1 0
45 50 1 0
50 51 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 623.74Molecular Weight (Monoisotopic): 623.2526AlogP: 2.24#Rotatable Bonds: 12Polar Surface Area: 165.83Molecular Species: BASEHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.84CX Basic pKa: 8.80CX LogP: 1.97CX LogD: 0.55Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.22Np Likeness Score: -1.70
References 1. Ferguson FM, Doctor ZM, Ficarro SB, Marto JA, Kim ND, Sim T, Gray NS.. (2019) Synthesis and structure activity relationships of a series of 4-amino-1H-pyrazoles as covalent inhibitors of CDK14., 29 (15): [PMID:31175010 ] [10.1016/j.bmcl.2019.05.024 ]