3-(4-Chlorobenzyl)-5-(3-methoxyphenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7(4H)-one

ID: ALA4564110

PubChem CID: 70937737

Max Phase: Preclinical

Molecular Formula: C21H18ClN3O2

Molecular Weight: 379.85

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2cc(=O)n3nc(C)c(Cc4ccc(Cl)cc4)c3[nH]2)cc1

Standard InChI:  InChI=1S/C21H18ClN3O2/c1-13-18(11-14-3-7-16(22)8-4-14)21-23-19(12-20(26)25(21)24-13)15-5-9-17(27-2)10-6-15/h3-10,12,23H,11H2,1-2H3

Standard InChI Key:  MJASFJWUMZDVEP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   31.6308   -5.6611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6290   -4.0237    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1432   -5.5046    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9228   -5.2521    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9225   -4.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1418   -4.1802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6623   -4.8455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1370   -3.3596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6228   -6.4756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3376   -4.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3425   -5.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0426   -4.0158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7525   -4.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7367   -2.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0352   -3.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4520   -3.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4538   -4.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8411   -4.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4271   -2.9510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4247   -2.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7156   -1.7223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0059   -2.1328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0096   -2.9562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7192   -3.3610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2934   -1.7211    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   35.1557   -2.7776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8615   -3.1862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  1 11  1  0
 10  2  1  0
  2  5  1  0
  4  5  1  0
  3  4  1  0
  5  6  2  0
  6  7  1  0
  7  3  2  0
  6  8  1  0
  1  9  2  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 13 17  1  0
 16 14  1  0
 14 15  2  0
 15 12  1  0
 16 17  2  0
  7 18  1  0
  8 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
 16 26  1  0
 26 27  1  0
M  END

Associated Targets(Human)

CSNK2A2 Tchem Casein kinase II alpha (prime) (1587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 379.85Molecular Weight (Monoisotopic): 379.1088AlogP: 4.25#Rotatable Bonds: 4
Polar Surface Area: 59.39Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.34CX Basic pKa: 0.58CX LogP: 4.07CX LogD: 4.07
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.58Np Likeness Score: -1.10

References

1.  (2012)  Heterocyclic compounds for the inhibition of pask, 

Source