3-(11-amino-3,7-dimethylundeca-1,3,5,7,9-pentaenyl)-2,4,4-trimethylcyclohex-2-enol

ID: ALA4564202

PubChem CID: 121373952

Max Phase: Preclinical

Molecular Formula: C22H33NO

Molecular Weight: 327.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/CN)C(C)(C)CCC1O

Standard InChI:  InChI=1S/C22H33NO/c1-17(9-6-7-16-23)10-8-11-18(2)12-13-20-19(3)21(24)14-15-22(20,4)5/h6-13,21,24H,14-16,23H2,1-5H3/b7-6+,10-8+,13-12+,17-9+,18-11+

Standard InChI Key:  AAUCQQJFPASRLF-LYEPCHNZSA-N

Molfile:  

 
     RDKit          2D

 24 24  0  0  0  0  0  0  0  0999 V2000
    1.4652   -3.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8779   -4.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2863   -3.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7504   -4.3790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0308   -4.3954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1832   -4.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8941   -4.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3199   -4.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6091   -4.3954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4640   -4.8029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7389   -4.8032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4462   -4.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1544   -4.8015    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0356   -4.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3234   -4.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5995   -4.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6101   -3.5783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7573   -3.5618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1593   -4.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1457   -5.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8601   -6.0082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5880   -5.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2896   -6.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8481   -6.8253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  8  1  0
  7  6  2  0
  8  9  2  0
  6 10  1  0
  9  7  1  0
 10  4  2  0
  4 14  1  0
  5 11  2  0
 11 12  1  0
 12 13  1  0
 14 15  2  0
 15 16  1  0
  9 17  1  0
  4 18  1  0
 16  2  1  0
 16 22  2  0
  2 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 21 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4564202

    ---

Associated Targets(non-human)

LRAT Lecithin retinol acyltransferase (88 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RPE65 Retinoid isomerohydrolase (75 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 327.51Molecular Weight (Monoisotopic): 327.2562AlogP: 5.00#Rotatable Bonds: 6
Polar Surface Area: 46.25Molecular Species: BASEHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.64CX LogP: 3.88CX LogD: 1.70
Aromatic Rings: Heavy Atoms: 24QED Weighted: 0.67Np Likeness Score: 2.31

References

1.  (2017)  Compounds and methods of treating ocular disorders, 

Source