The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 4-ethyl-3-((4-(furan-3-ylmethyl)-5-(4-(trifluoromethyl)phenyl)-4H-1,2,4-triazol-3-ylthio)methyl)benzoate ID: ALA4564787
PubChem CID: 132070998
Max Phase: Preclinical
Molecular Formula: C25H22F3N3O3S
Molecular Weight: 501.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(C(=O)OC)cc1CSc1nnc(-c2ccc(C(F)(F)F)cc2)n1Cc1ccoc1
Standard InChI: InChI=1S/C25H22F3N3O3S/c1-3-17-4-5-19(23(32)33-2)12-20(17)15-35-24-30-29-22(31(24)13-16-10-11-34-14-16)18-6-8-21(9-7-18)25(26,27)28/h4-12,14H,3,13,15H2,1-2H3
Standard InChI Key: HXLDDLPDZIPZAU-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
8.2325 -8.2397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8943 -7.7471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6322 -6.9648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8047 -6.9739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5618 -7.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6816 -7.9940 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.2409 -9.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9595 -9.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0574 -10.2878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8660 -10.4512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2713 -9.7325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7130 -9.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2889 -7.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0762 -7.6825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2519 -8.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0382 -8.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6466 -8.1748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4633 -7.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6771 -7.1228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4931 -6.3186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0975 -5.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2176 -9.5386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6101 -10.0966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0048 -9.7859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7895 -10.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7802 -8.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1626 -7.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3817 -7.7416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2192 -8.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8438 -9.0968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6223 -8.8302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4381 -8.8166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8177 -8.2727 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.2772 -9.6259 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.6376 -9.0252 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
2 6 1 0
1 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
6 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
19 20 1 0
20 21 1 0
16 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
5 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.53Molecular Weight (Monoisotopic): 501.1334AlogP: 6.25#Rotatable Bonds: 8Polar Surface Area: 70.15Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.31CX LogP: 6.78CX LogD: 6.78Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.21Np Likeness Score: -1.41
References 1. (2017) Inhibitors of grb2-associated binding protein 1 (gab1) and methods of treating cancer using the same,