1-Benzyl-4-(benzylamino)-5-methylpyrimidin-2(1H)-one

ID: ALA4565182

PubChem CID: 155560175

Max Phase: Preclinical

Molecular Formula: C19H19N3O

Molecular Weight: 305.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cn(Cc2ccccc2)c(=O)nc1NCc1ccccc1

Standard InChI:  InChI=1S/C19H19N3O/c1-15-13-22(14-17-10-6-3-7-11-17)19(23)21-18(15)20-12-16-8-4-2-5-9-16/h2-11,13H,12,14H2,1H3,(H,20,21,23)

Standard InChI Key:  NSBNPBGFWZGBFO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   29.3225   -4.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3214   -5.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0294   -5.5827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7391   -5.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7363   -4.3506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.0277   -3.9453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6147   -3.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4475   -5.5807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0292   -6.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0252   -3.1281    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7368   -6.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7325   -7.6241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4393   -8.0327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1481   -7.6243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1457   -6.8029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4383   -6.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7317   -2.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7293   -1.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4412   -1.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4391   -0.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7296   -0.2682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0208   -0.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0264   -1.4984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  4  8  2  0
  3  9  1  0
  6 10  1  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 10 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4565182

    ---

Associated Targets(non-human)

Tlr4 Toll-like receptor 4 (76 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 305.38Molecular Weight (Monoisotopic): 305.1528AlogP: 3.21#Rotatable Bonds: 5
Polar Surface Area: 46.92Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.11CX LogD: 3.11
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.79Np Likeness Score: -0.95

References

1. Trifonov L, Nudelman V, Zhenin M, Matsree E, Afri M, Schmerling B, Cohen G, Jozwiak K, Weitman M, Korshin E, Senderowitz H, Shainberg A, Hochhauser E, Gruzman A..  (2018)  Structurally Simple, Readily Available Peptidomimetic 1-Benzyl-5-methyl-4-( n-octylamino)pyrimidin-2(1 H)-one Exhibited Efficient Cardioprotection in a Myocardial Ischemia (MI) Mouse Model.,  61  (24): [PMID:30507195] [10.1021/acs.jmedchem.8b01471]

Source