(R)-2-((5aR,6R,8R,9aR,10R)-6,10-dihydroxy-5a-methyl-1-oxo-3-(pyridin-3-yl)-1,5a,6,7,8,9,9a,10-octahydropyrano[4,3-b]chromen-8-yl)propane-1,2-diyl diacetate

ID: ALA4565264

PubChem CID: 145154669

Max Phase: Preclinical

Molecular Formula: C25H29NO9

Molecular Weight: 487.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)OC[C@](C)(OC(C)=O)[C@H]1C[C@@H](O)[C@]2(C)Oc3cc(-c4cccnc4)oc(=O)c3[C@H](O)[C@H]2C1

Standard InChI:  InChI=1S/C25H29NO9/c1-13(27)32-12-24(3,34-14(2)28)16-8-17-22(30)21-19(35-25(17,4)20(29)9-16)10-18(33-23(21)31)15-6-5-7-26-11-15/h5-7,10-11,16-17,20,22,29-30H,8-9,12H2,1-4H3/t16-,17-,20-,22-,24+,25-/m1/s1

Standard InChI Key:  IQTLJIZQLZRFRU-BTUXNFOLSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    7.7221  -24.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1463  -24.9456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4342  -23.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1445  -24.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8592  -23.7205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8698  -22.8960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1595  -22.4763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4386  -22.8809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4342  -25.3541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7221  -24.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0161  -25.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0162  -26.1762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7285  -26.5846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4405  -26.1726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7276  -22.4622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3024  -26.5899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1568  -26.5822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5871  -26.1784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3037  -27.4149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5859  -25.3533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8707  -24.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8694  -24.1166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1568  -25.3554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4264  -24.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7179  -25.7708    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5879  -22.4926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2978  -22.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0167  -22.5115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0266  -21.6855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3118  -21.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5960  -21.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2968  -25.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5897  -27.8287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5909  -28.6536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8745  -27.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0063  -23.7101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0162  -27.0012    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1 10  1  0
  1  3  1  0
  9  2  1  0
  2  4  1  0
  3  4  2  0
  3  8  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  8 15  2  0
 12 16  1  0
 14 17  1  6
 16 18  1  1
 16 19  1  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
  9 24  1  6
 10 25  1  1
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  6 26  1  0
 16 32  1  0
 19 33  1  0
 33 34  2  0
 33 35  1  0
  1 36  1  1
 12 37  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4565264

    ---

Associated Targets(Human)

SOAT2 Tchem Acyl coenzyme A:cholesterol acyltransferase 2 (288 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.51Molecular Weight (Monoisotopic): 487.1842AlogP: 2.16#Rotatable Bonds: 5
Polar Surface Area: 145.39Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.60CX Basic pKa: 4.21CX LogP: -0.33CX LogD: -0.33
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.60Np Likeness Score: 1.20

References

1.  (2016)  Class of tricyclic analogue, preparation method and use thereof, 

Source