2-[(3S,4R)-1-{[2-chloro-6-(trifluoromethyl)phenyl]methyl}-3-{[1-(2-fluoropentyl)piperidin-4-yl]carbamoyl}-4-methylpyrrolidin-3-yl]acetic acid

ID: ALA4565523

PubChem CID: 71293703

Max Phase: Preclinical

Molecular Formula: C26H36ClF4N3O3

Molecular Weight: 550.04

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCC(F)CN1CCC(NC(=O)[C@]2(CC(=O)O)CN(Cc3c(Cl)cccc3C(F)(F)F)C[C@@H]2C)CC1

Standard InChI:  InChI=1S/C26H36ClF4N3O3/c1-3-5-18(28)14-33-10-8-19(9-11-33)32-24(37)25(12-23(35)36)16-34(13-17(25)2)15-20-21(26(29,30)31)6-4-7-22(20)27/h4,6-7,17-19H,3,5,8-16H2,1-2H3,(H,32,37)(H,35,36)/t17-,18?,25+/m0/s1

Standard InChI Key:  JXBBOBNZJSUUDJ-BNSZOAOKSA-N

Molfile:  

 
     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
    9.5051   -7.9545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8391   -7.4702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0949   -6.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9193   -6.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1710   -7.4702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7163   -6.4732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9256   -5.6762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2957   -7.0567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0927   -6.8433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3061   -6.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1031   -5.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6866   -6.4165    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4732   -7.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6762   -7.4269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4794   -6.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0630   -6.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8599   -6.5731    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.8496   -7.5836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4331   -8.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2301   -7.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7059   -5.8896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9090   -5.6762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6956   -4.8834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3254   -6.2598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2703   -6.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5051   -8.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7925   -9.1936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7921  -10.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0780  -10.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3651  -10.0154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3629   -9.1924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0756   -8.7766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0756   -7.9562    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.5048  -10.4286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2214  -10.0183    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.5048  -11.2532    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.2214  -10.8388    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  4  6  1  6
  6  7  2  0
  6  8  1  0
  8  9  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
  9 14  1  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
  4 21  1  0
 21 22  1  0
 22 23  2  0
 22 24  1  0
  3 25  1  6
  1 26  1  0
 26 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
 32 33  1  0
 28 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
M  END

Associated Targets(Human)

CX3CR1 Tchem C-X3-C chemokine receptor 1 (1686 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 550.04Molecular Weight (Monoisotopic): 549.2381AlogP: 4.99#Rotatable Bonds: 10
Polar Surface Area: 72.88Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.92CX Basic pKa: 8.46CX LogP: 1.30CX LogD: 1.07
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.40Np Likeness Score: -0.70

References

1.  (2014)  Pyrrolidine-3-ylacetic acid derivative, 

Source