2-(5-(4-(5-(4-hydroxy-2-methoxyphenyl)-1,3,4-oxadiazol-2-yl)phenyl)-1,3,4-thia-diazol-2-yl)benzene-1,4-diol

ID: ALA4565724

PubChem CID: 155560145

Max Phase: Preclinical

Molecular Formula: C23H16N4O5S

Molecular Weight: 460.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)ccc1-c1nnc(-c2ccc(-c3nnc(-c4cc(O)ccc4O)s3)cc2)o1

Standard InChI:  InChI=1S/C23H16N4O5S/c1-31-19-11-15(29)6-8-16(19)21-25-24-20(32-21)12-2-4-13(5-3-12)22-26-27-23(33-22)17-10-14(28)7-9-18(17)30/h2-11,28-30H,1H3

Standard InChI Key:  IYRMDXYWLSNSFW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   10.8945  -10.0085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8933  -10.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6014  -11.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3110  -10.8276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3082  -10.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5996   -9.5996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1853  -11.2361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5971   -8.7824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8882   -8.3760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0121   -9.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7599   -9.9248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3044   -9.3155    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8932   -8.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0367   -8.7823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2196   -7.8634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0332   -7.7761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3628   -7.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8797   -6.3689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0634   -6.4605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7376   -7.2077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2046   -5.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0030   -5.4481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0842   -4.6350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3359   -4.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7924   -4.8877    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.1714   -3.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7835   -2.9658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6195   -2.1660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8434   -1.9075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2309   -2.4549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3980   -3.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5585   -3.2250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4546   -2.1998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  6  8  1  0
  8  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
  5 10  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
 18 21  1  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 27 32  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4565724

    ---

Associated Targets(Human)

GUSB Tchem Beta-glucuronidase (537 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.47Molecular Weight (Monoisotopic): 460.0841AlogP: 4.71#Rotatable Bonds: 5
Polar Surface Area: 134.62Molecular Species: NEUTRALHBA: 10HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.25CX Basic pKa: CX LogP: 3.76CX LogD: 3.70
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -0.35

References

1. Taha M, Imran S, Alomari M, Rahim F, Wadood A, Mosaddik A, Uddin N, Gollapalli M, Alqahtani MA, Bamarouf YA..  (2019)  Synthesis of oxadiazole-coupled-thiadiazole derivatives as a potent β-glucuronidase inhibitors and their molecular docking study.,  27  (14): [PMID:31196753] [10.1016/j.bmc.2019.05.049]

Source