The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-5-((30-methoxy-5'-(2-methoxyethoxy)-[1,1'-biphenyl]-4-yl)methyl)-3,7-dihydro-4H-pyrrolo [2,3-d]pyrimidin-4-one ID: ALA4565818
PubChem CID: 155545263
Max Phase: Preclinical
Molecular Formula: C23H24N4O4
Molecular Weight: 420.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COCCOc1cc(OC)cc(-c2ccc(Cc3c[nH]c4nc(N)[nH]c(=O)c34)cc2)c1
Standard InChI: InChI=1S/C23H24N4O4/c1-29-7-8-31-19-11-16(10-18(12-19)30-2)15-5-3-14(4-6-15)9-17-13-25-21-20(17)22(28)27-23(24)26-21/h3-6,10-13H,7-9H2,1-2H3,(H4,24,25,26,27,28)
Standard InChI Key: FRDOZQCDHFDZKR-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
28.9525 -4.5482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.9525 -5.3654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6578 -5.7699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6578 -4.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3631 -4.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3675 -5.3619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1428 -5.6091 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6175 -4.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1355 -4.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6578 -3.3183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2454 -5.7750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3838 -3.5140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1822 -3.3397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7289 -3.9475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5266 -3.7737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7755 -2.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2206 -2.3888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4249 -2.5657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5726 -2.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1233 -3.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9208 -3.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1687 -2.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6129 -1.8657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8175 -2.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8574 -1.0859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6549 -0.9077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4714 -3.8540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2238 -4.6328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7745 -5.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5269 -6.0154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0775 -6.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 2 0
2 11 1 0
9 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
16 19 1 0
23 25 1 0
25 26 1 0
21 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.47Molecular Weight (Monoisotopic): 420.1798AlogP: 3.13#Rotatable Bonds: 8Polar Surface Area: 115.25Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.06CX Basic pKa: 2.71CX LogP: 3.04CX LogD: 3.04Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.38Np Likeness Score: -0.31
References 1. Czyzyk DJ, Valhondo M, Deiana L, Tirado-Rives J, Jorgensen WL, Anderson KS.. (2019) Structure activity relationship towards design of cryptosporidium specific thymidylate synthase inhibitors., 183 [PMID:31536894 ] [10.1016/j.ejmech.2019.111673 ]