2-Amino-5-((30-methoxy-5'-(2-methoxyethoxy)-[1,1'-biphenyl]-4-yl)methyl)-3,7-dihydro-4H-pyrrolo [2,3-d]pyrimidin-4-one

ID: ALA4565818

PubChem CID: 155545263

Max Phase: Preclinical

Molecular Formula: C23H24N4O4

Molecular Weight: 420.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCCOc1cc(OC)cc(-c2ccc(Cc3c[nH]c4nc(N)[nH]c(=O)c34)cc2)c1

Standard InChI:  InChI=1S/C23H24N4O4/c1-29-7-8-31-19-11-16(10-18(12-19)30-2)15-5-3-14(4-6-15)9-17-13-25-21-20(17)22(28)27-23(24)26-21/h3-6,10-13H,7-9H2,1-2H3,(H4,24,25,26,27,28)

Standard InChI Key:  FRDOZQCDHFDZKR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   28.9525   -4.5482    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.9525   -5.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6578   -5.7699    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.6578   -4.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3631   -4.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3675   -5.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1428   -5.6091    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6175   -4.9482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1355   -4.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6578   -3.3183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2454   -5.7750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3838   -3.5140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1822   -3.3397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7289   -3.9475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5266   -3.7737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7755   -2.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2206   -2.3888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4249   -2.5657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5726   -2.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1233   -3.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9208   -3.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1687   -2.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6129   -1.8657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8175   -2.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8574   -1.0859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6549   -0.9077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4714   -3.8540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.2238   -4.6328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7745   -5.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5269   -6.0154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0775   -6.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  4 10  2  0
  2 11  1  0
  9 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 16 19  1  0
 23 25  1  0
 25 26  1  0
 21 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4565818

    ---

Associated Targets(non-human)

Bifunctional dihydrofolate reductase-thymidylate synthase (81 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.47Molecular Weight (Monoisotopic): 420.1798AlogP: 3.13#Rotatable Bonds: 8
Polar Surface Area: 115.25Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 11.06CX Basic pKa: 2.71CX LogP: 3.04CX LogD: 3.04
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.38Np Likeness Score: -0.31

References

1. Czyzyk DJ, Valhondo M, Deiana L, Tirado-Rives J, Jorgensen WL, Anderson KS..  (2019)  Structure activity relationship towards design of cryptosporidium specific thymidylate synthase inhibitors.,  183  [PMID:31536894] [10.1016/j.ejmech.2019.111673]

Source