(4S)-5-[[(1S)-5-amino-1-[[(1S)-1-[[(1S)-2-amino-1-methyl-2-oxo-ethyl]carbamoyl]-3-methyl-butyl]carbamoyl]pentyl]amino]-4-[[(2S)-6-amino-2-[[(2S)-2-[[(2S,3R)-2-[[(2S)-2-aminopropanoyl]amino]-3-hydroxy-butanoyl]amino]-4-methyl-pentanoyl]amino]hexanoyl]amino]-5-oxo-pentanoic acid

ID: ALA4566089

PubChem CID: 155550939

Max Phase: Preclinical

Molecular Formula: C39H73N11O11

Molecular Weight: 872.08

Molecule Type: Unknown

Associated Items:

Bioactivity Summary Target Summary Assay Summary

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES: CC(C)C[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](C)N)[C@@H](C)O)C(=O)N[C@@H](C)C(N)=O

Standard InChI: InChI=1S/C39H73N11O11/c1-20(2)18-28(37(59)44-23(6)32(43)54)48-35(57)26(13-9-11-17-41)45-36(58)27(14-15-30(52)53)47-34(56)25(12-8-10-16-40)46-38(60)29(19-21(3)4)49-39(61)31(24(7)51)50-33(55)22(5)42/h20-29,31,51H,8-19,40-42H2,1-7H3,(H2,43,54)(H,44,59)(H,45,58)(H,46,60)(H,47,56)(H,48,57)(H,49,61)(H,50,55)(H,52,53)/t22-,23-,24+,25-,26-,27-,28-,29-,31-/m0/s1

Standard InChI Key: DBJSHCSPBIGIHR-YVKWPFAXSA-N

Molfile:

 
     RDKit          2D

 61 60  0  0  0  0  0  0  0  0999 V2000
   22.7658   -5.6791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4735   -5.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1812   -5.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8889   -5.2705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1812   -6.4963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5966   -5.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3043   -5.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0120   -5.6791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3043   -4.4533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7198   -5.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4275   -5.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1352   -5.2705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.4275   -6.4963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8429   -5.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5506   -5.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2583   -5.6791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.5506   -4.4533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9660   -5.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6737   -5.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3814   -5.2705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6737   -6.4963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.0891   -5.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7968   -5.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5045   -5.6791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7968   -4.4533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.2123   -5.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9200   -5.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6277   -5.2705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.9200   -6.4963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.3354   -5.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0431   -5.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0431   -4.4533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4735   -4.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5966   -6.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8889   -6.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3043   -6.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7198   -4.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4275   -4.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4275   -3.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1352   -4.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8429   -6.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0891   -6.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3354   -6.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5506   -6.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5506   -7.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2583   -8.1306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2583   -8.9478    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.9660   -4.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2123   -4.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6737   -4.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6737   -3.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3814   -2.8189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9660   -2.8189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7968   -6.9048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7968   -7.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5045   -8.1306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5045   -8.9478    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.9200   -4.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9200   -3.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6277   -4.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7508   -5.6791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  6  4  1  6
  6  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 30 28  1  6
 30 31  1  0
 31 32  2  0
  2 33  1  1
  6 34  1  0
 34 35  1  0
 34 36  1  6
 10 37  1  1
 37 38  1  0
 38 39  1  0
 38 40  1  0
 14 41  1  6
 22 42  1  6
 30 43  1  0
 41 44  1  0
 44 45  1  0
 45 46  1  0
 46 47  1  0
 18 48  1  1
 26 49  1  1
 48 50  1  0
 50 51  1  0
 51 52  2  0
 51 53  1  0
 42 54  1  0
 54 55  1  0
 55 56  1  0
 56 57  1  0
 49 58  1  0
 58 59  1  0
 58 60  1  0
 31 61  1  0
M  END

Natural Product: No	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Unknown	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 872.08	Molecular Weight (Monoisotopic): 871.5491	AlogP: -3.17	#Rotatable Bonds: 31
Polar Surface Area: 382.38	Molecular Species: ZWITTERION	HBA: 13	HBD: 13
#RO5 Violations: 3	HBA (Lipinski): 22	HBD (Lipinski): 17	#RO5 Violations (Lipinski): 3
CX Acidic pKa: 4.00	CX Basic pKa: 13.51	CX LogP: -6.47	CX LogD: -9.30
Aromatic Rings: ┄	Heavy Atoms: 61	QED Weighted: 0.03	Np Likeness Score: 0.24

References

1. Thabault L, Brisson L, Brustenga C, Martinez Gache SA, Prévost JRC, Kozlova A, Spillier Q, Liberelle M, Benyahia Z, Messens J, Copetti T, Sonveaux P, Frédérick R.. (2020) Interrogating the Lactate Dehydrogenase Tetramerization Site Using (Stapled) Peptides., 63 (9): [PMID:32250117] [10.1021/acs.jmedchem.9b01955]

(4S)-5-[[(1S)-5-amino-1-[[(1S)-1-[[(1S)-2-amino-1-methyl-2-oxo-ethyl]carbamoyl]-3-methyl-butyl]carbamoyl]pentyl]amino]-4-[[(2S)-6-amino-2-[[(2S)-2-[[(2S,3R)-2-[[(2S)-2-aminopropanoyl]amino]-3-hydroxy-butanoyl]amino]-4-methyl-pentanoyl]amino]hexanoyl]amino]-5-oxo-pentanoic acid

Names and Identifiers

Alternative Forms

Associated Targets(Human)

Molecule Features

Drug Indications

Mechanisms of Action

Calculated Properties

References

Source