(S)-1-((4-(3-((2-Aminoethyl)disulfanyl)propoxy)-3-methoxyphenethyl)amino)-3-(4-(2-methoxyethyl)phenoxy)propan-2-ol

ID: ALA4566666

PubChem CID: 155561031

Max Phase: Preclinical

Molecular Formula: C26H40N2O5S2

Molecular Weight: 524.75

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCCc1ccc(OC[C@@H](O)CNCCc2ccc(OCCCSSCCN)c(OC)c2)cc1

Standard InChI:  InChI=1S/C26H40N2O5S2/c1-30-15-11-21-4-7-24(8-5-21)33-20-23(29)19-28-13-10-22-6-9-25(26(18-22)31-2)32-14-3-16-34-35-17-12-27/h4-9,18,23,28-29H,3,10-17,19-20,27H2,1-2H3/t23-/m0/s1

Standard InChI Key:  YHBXEUIDXLFNRE-QHCPKHFHSA-N

Molfile:  

 
     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
    5.3613   -2.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0731   -1.9068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7849   -2.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4968   -1.9068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2086   -2.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4968   -1.0855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9204   -1.9068    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6323   -2.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3400   -1.9068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9422   -3.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6549   -3.5465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3633   -3.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9427   -2.3159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6478   -1.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0518   -2.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0500   -3.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7610   -3.5504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4738   -3.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4712   -2.3162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7596   -1.9073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1815   -1.9010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1862   -3.5494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1787   -1.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8974   -3.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6098   -3.5475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3211   -3.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0294   -3.5456    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.7407   -3.1361    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.4530   -3.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1643   -3.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8767   -3.5419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2309   -3.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5186   -3.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8073   -3.5495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0949   -3.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  1  1
  5  7  1  0
  7  8  1  0
  8  9  1  0
  1 14  2  0
 13 10  2  0
 10 11  1  0
 11 12  2  0
 12  1  1  0
 13 14  1  0
  9 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 18 22  1  0
 21 23  1  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 10 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4566666

    ---

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Adrb1 Beta-1 adrenergic receptor (53 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.75Molecular Weight (Monoisotopic): 524.2379AlogP: 3.57#Rotatable Bonds: 20
Polar Surface Area: 95.20Molecular Species: BASEHBA: 9HBD: 3
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.79CX LogP: 2.84CX LogD: -1.20
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.18Np Likeness Score: -0.27

References

1. Schwalbe T, Huebner H, Gmeiner P..  (2019)  Development of covalent antagonists for β1- and β2-adrenergic receptors.,  27  (13): [PMID:31151791] [10.1016/j.bmc.2019.05.034]

Source