The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy)-5-(1-(fluoroethylpiperidin-4-yl)-1H-pyrazol-4-yl)pyridin-2-amine ID: ALA4566676
PubChem CID: 155561036
Max Phase: Preclinical
Molecular Formula: C23H25Cl2F2N5O
Molecular Weight: 496.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](Oc1cc(-c2cnn(C3CCN(CCF)CC3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl
Standard InChI: InChI=1S/C23H25Cl2F2N5O/c1-14(21-18(24)2-3-19(27)22(21)25)33-20-10-15(11-29-23(20)28)16-12-30-32(13-16)17-4-7-31(8-5-17)9-6-26/h2-3,10-14,17H,4-9H2,1H3,(H2,28,29)/t14-/m1/s1
Standard InChI Key: BLSYKOYSZFDNDF-CQSZACIVSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
6.4866 -16.8473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4854 -17.6668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1935 -18.0758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9031 -17.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9003 -16.8437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1917 -16.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7774 -18.0749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6043 -16.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3520 -16.7637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8966 -16.1543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4853 -15.4481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6866 -15.6211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8158 -14.7004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6293 -14.6137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9592 -13.8700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4795 -13.2079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6660 -13.2946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3321 -14.0433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7788 -16.4389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7786 -15.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0708 -15.2133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0759 -14.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3689 -13.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6603 -14.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6631 -15.2172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3707 -15.6218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3743 -16.4390 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.7849 -13.9890 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.9570 -15.6285 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.4862 -15.2129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8119 -12.4614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6246 -12.3759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9569 -11.6293 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 8 2 0
5 8 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
11 13 1 0
1 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
26 27 1 0
22 28 1 0
25 29 1 0
20 30 1 1
16 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.39Molecular Weight (Monoisotopic): 495.1404AlogP: 5.72#Rotatable Bonds: 7Polar Surface Area: 69.20Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.77CX LogP: 4.16CX LogD: 3.63Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -1.21
References 1. Radaram B, Pisaneschi F, Rao Y, Yang P, Piwnica-Worms D, Alauddin MM.. (2019) Novel derivatives of anaplastic lymphoma kinase inhibitors: Synthesis, radiolabeling, and preliminary biological studies of fluoroethyl analogues of crizotinib, alectinib, and ceritinib., 182 [PMID:31425908 ] [10.1016/j.ejmech.2019.111571 ]