3-((R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy)-5-(1-(fluoroethylpiperidin-4-yl)-1H-pyrazol-4-yl)pyridin-2-amine

ID: ALA4566676

PubChem CID: 155561036

Max Phase: Preclinical

Molecular Formula: C23H25Cl2F2N5O

Molecular Weight: 496.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H](Oc1cc(-c2cnn(C3CCN(CCF)CC3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl

Standard InChI:  InChI=1S/C23H25Cl2F2N5O/c1-14(21-18(24)2-3-19(27)22(21)25)33-20-10-15(11-29-23(20)28)16-12-30-32(13-16)17-4-7-31(8-5-17)9-6-26/h2-3,10-14,17H,4-9H2,1H3,(H2,28,29)/t14-/m1/s1

Standard InChI Key:  BLSYKOYSZFDNDF-CQSZACIVSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    6.4866  -16.8473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4854  -17.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1935  -18.0758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9031  -17.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9003  -16.8437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1917  -16.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7774  -18.0749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6043  -16.4341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3520  -16.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8966  -16.1543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4853  -15.4481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6866  -15.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8158  -14.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6293  -14.6137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9592  -13.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4795  -13.2079    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6660  -13.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3321  -14.0433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7788  -16.4389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7786  -15.6217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0708  -15.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0759  -14.3953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3689  -13.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6603  -14.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6631  -15.2172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3707  -15.6218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3743  -16.4390    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.7849  -13.9890    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.9570  -15.6285    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.4862  -15.2129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8119  -12.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6246  -12.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9569  -11.6293    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12  8  2  0
  5  8  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 11 13  1  0
  1 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 26 27  1  0
 22 28  1  0
 25 29  1  0
 20 30  1  1
 16 31  1  0
 31 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Alternative Forms:

    ALA4566676

    ---
  2. Parent:

    ALA4566676

    ---

Associated Targets(Human)

NCI-H2228 (1030 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.39Molecular Weight (Monoisotopic): 495.1404AlogP: 5.72#Rotatable Bonds: 7
Polar Surface Area: 69.20Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.77CX LogP: 4.16CX LogD: 3.63
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -1.21

References

1. Radaram B, Pisaneschi F, Rao Y, Yang P, Piwnica-Worms D, Alauddin MM..  (2019)  Novel derivatives of anaplastic lymphoma kinase inhibitors: Synthesis, radiolabeling, and preliminary biological studies of fluoroethyl analogues of crizotinib, alectinib, and ceritinib.,  182  [PMID:31425908] [10.1016/j.ejmech.2019.111571]

Source