The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl (3-methyl-3-((2-(pyridin-4-yl)pyrido[3,4-d]pyrimidin-4-yl)amino)butyl)carbamate ID: ALA4566717
PubChem CID: 145744600
Max Phase: Preclinical
Molecular Formula: C22H28N6O2
Molecular Weight: 408.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(CCNC(=O)OC(C)(C)C)Nc1nc(-c2ccncc2)nc2cnccc12
Standard InChI: InChI=1S/C22H28N6O2/c1-21(2,3)30-20(29)25-13-9-22(4,5)28-19-16-8-12-24-14-17(16)26-18(27-19)15-6-10-23-11-7-15/h6-8,10-12,14H,9,13H2,1-5H3,(H,25,29)(H,26,27,28)
Standard InChI Key: IFLQSICQUWYBAW-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
17.7760 -2.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1887 -3.5618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5971 -2.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9027 -3.9745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6230 -7.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0354 -6.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2993 -5.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0354 -4.8036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1804 -5.2157 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9164 -6.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9164 -7.3061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7378 -5.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6214 -6.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2993 -6.0401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4738 -6.4524 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4750 -3.9778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3582 -6.4447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1804 -6.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7378 -6.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3590 -7.3061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4738 -4.8036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6286 -3.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3317 -3.9826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0440 -3.5820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7471 -3.9984 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4593 -3.5978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1624 -4.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4684 -2.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1620 -3.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0531 -2.7648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
18 9 2 0
4 22 1 0
6 14 2 0
17 20 2 0
15 19 2 0
18 10 1 0
12 21 2 0
19 12 1 0
18 15 1 0
7 14 1 0
21 16 1 0
10 11 1 0
5 20 1 0
11 5 2 0
21 9 1 0
13 17 1 0
8 7 2 0
19 6 1 0
16 2 1 0
2 4 1 0
12 8 1 0
13 10 2 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
24 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.51Molecular Weight (Monoisotopic): 408.2274AlogP: 4.19#Rotatable Bonds: 6Polar Surface Area: 101.92Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.31CX LogP: 2.74CX LogD: 2.74Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -1.12
References 1. (2018) 6-6 Fused Bicyclic Heteroaryl Compounds and their Use as LATS Inhibitors,