The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl (R)-2-(6-amino-5-(1-(2,6-dichloro-3-fluorophenyl)ethoxy)-2'-oxo-[3,4'-bipyridin]-1'(2'H)-yl)acetate ID: ALA4566804
PubChem CID: 155543509
Max Phase: Preclinical
Molecular Formula: C22H20Cl2FN3O4
Molecular Weight: 480.32
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)Cn1ccc(-c2cnc(N)c(O[C@H](C)c3c(Cl)ccc(F)c3Cl)c2)cc1=O
Standard InChI: InChI=1S/C22H20Cl2FN3O4/c1-3-31-19(30)11-28-7-6-13(9-18(28)29)14-8-17(22(26)27-10-14)32-12(2)20-15(23)4-5-16(25)21(20)24/h4-10,12H,3,11H2,1-2H3,(H2,26,27)/t12-/m1/s1
Standard InChI Key: YYIUNFDHPBMIHQ-GFCCVEGCSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
18.3652 -13.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3641 -13.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0789 -14.3444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7954 -13.9311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7925 -13.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0771 -12.6913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6514 -12.6874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6532 -11.8615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9428 -11.4492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2259 -11.8583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2242 -12.6843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9391 -13.1011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5104 -14.3424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9457 -10.6242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5054 -12.6853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5023 -11.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2152 -11.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9265 -11.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6389 -11.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6362 -10.6181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9151 -10.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2057 -10.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7863 -11.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9267 -12.6835 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.4873 -10.2197 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
23.3547 -11.8541 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.5129 -11.4433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7970 -11.8533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7940 -12.6783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0840 -11.4383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3680 -11.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6551 -11.4332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
1 7 1 0
4 13 1 0
9 14 2 0
5 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
16 23 1 6
18 24 1 0
22 25 1 0
19 26 1 0
10 27 1 0
27 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.32Molecular Weight (Monoisotopic): 479.0815AlogP: 4.64#Rotatable Bonds: 7Polar Surface Area: 96.44Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.97CX LogP: 3.62CX LogD: 3.60Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: -1.13
References 1. Chen W, Guo X, Zhang C, Ke D, Zhang G, Yu Y.. (2019) Discovery of 2-aminopyridines bearing a pyridone moiety as potent ALK inhibitors to overcome the crizotinib-resistant mutants., 183 [PMID:31569004 ] [10.1016/j.ejmech.2019.111734 ]