The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-Hydroxy-2-oxo-1-(2-oxo-1,2,3,4-tetrahydro-quinolin-6-yl)-pyrrolidine-3-carboxylic Acid 2,6-Difluoro-benzylamide ID: ALA4566917
PubChem CID: 71815258
Max Phase: Preclinical
Molecular Formula: C21H19F2N3O4
Molecular Weight: 415.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CCc2cc(N3CC[C@](O)(C(=O)NCc4c(F)cccc4F)C3=O)ccc2N1
Standard InChI: InChI=1S/C21H19F2N3O4/c22-15-2-1-3-16(23)14(15)11-24-19(28)21(30)8-9-26(20(21)29)13-5-6-17-12(10-13)4-7-18(27)25-17/h1-3,5-6,10,30H,4,7-9,11H2,(H,24,28)(H,25,27)/t21-/m0/s1
Standard InChI Key: MRAITFMPEIETKJ-NRFANRHFSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
6.0337 -4.0585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6125 -4.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4143 -4.4675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4143 -3.6462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1239 -4.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8357 -4.4664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5435 -4.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2512 -4.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2512 -5.2870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9658 -5.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6674 -5.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6674 -4.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9633 -4.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9633 -3.2371 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.5435 -5.6968 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.1239 -3.2369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8238 -5.1747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2776 -5.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5270 -5.4500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8192 -5.8598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8192 -6.6752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1176 -7.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4071 -6.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6991 -7.0904 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9911 -6.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2792 -7.0902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9911 -5.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6991 -5.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4071 -5.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1151 -5.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
3 4 1 6
3 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 8 2 0
13 14 1 0
9 15 1 0
5 16 2 0
3 17 1 0
17 18 1 0
18 19 1 0
2 19 1 0
20 19 1 0
21 20 2 0
22 21 1 0
23 22 2 0
23 24 1 0
25 24 1 0
25 26 2 0
27 25 1 0
28 27 1 0
29 28 1 0
29 23 1 0
30 29 2 0
20 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 415.40Molecular Weight (Monoisotopic): 415.1344AlogP: 1.63#Rotatable Bonds: 4Polar Surface Area: 98.74Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.76CX Basic pKa: ┄CX LogP: 1.19CX LogD: 1.19Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.66Np Likeness Score: -0.91
References 1. Heinrich T, Seenisamy J, Becker F, Blume B, Bomke J, Dietz M, Eckert U, Friese-Hamim M, Gunera J, Hansen K, Leuthner B, Musil D, Pfalzgraf J, Rohdich F, Siegl C, Spuck D, Wegener A, Zenke FT.. (2019) Identification of Methionine Aminopeptidase-2 (MetAP-2) Inhibitor M8891: A Clinical Compound for the Treatment of Cancer., 62 (24): [PMID:31725285 ] [10.1021/acs.jmedchem.9b01070 ]