The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Adamantan-1-yl-3-[8-(7-methoxy-1,2,3,4-tetrahydro-acridin-9-ylamino)-octyl]-thiourea ID: ALA4566976
PubChem CID: 155543947
Max Phase: Preclinical
Molecular Formula: C33H48N4OS
Molecular Weight: 548.84
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2nc3c(c(NCCCCCCCCNC(=S)NC45CC6CC(CC(C6)C4)C5)c2c1)CCCC3
Standard InChI: InChI=1S/C33H48N4OS/c1-38-26-12-13-30-28(19-26)31(27-10-6-7-11-29(27)36-30)34-14-8-4-2-3-5-9-15-35-32(39)37-33-20-23-16-24(21-33)18-25(17-23)22-33/h12-13,19,23-25H,2-11,14-18,20-22H2,1H3,(H,34,36)(H2,35,37,39)
Standard InChI Key: XKQZQFKGCCBLCH-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
38.3690 -6.9177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1357 -6.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7374 -5.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9810 -4.8298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2689 -5.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6126 -6.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8994 -5.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6398 -4.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4677 -5.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2970 -4.3906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9340 -4.4388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2224 -4.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5125 -4.4388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8067 -4.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0968 -4.4388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3852 -4.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6794 -4.4388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9695 -4.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2638 -4.4388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5580 -4.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8464 -4.4388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1365 -4.8535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.1365 -5.6688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4308 -6.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4308 -6.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1401 -7.3029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8408 -6.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8408 -6.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5525 -5.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2624 -6.0763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2624 -6.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5525 -7.3045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7173 -7.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0111 -6.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0074 -6.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7129 -5.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3016 -5.6675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5900 -6.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2224 -5.6688 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 4 1 0
6 5 1 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
2 9 1 0
10 8 1 0
4 10 1 0
11 8 1 0
12 11 1 0
13 12 1 0
14 13 1 0
15 14 1 0
16 15 1 0
17 16 1 0
18 17 1 0
19 18 1 0
20 19 1 0
21 20 1 0
22 21 1 0
23 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
28 29 1 0
30 29 1 0
31 30 1 0
32 31 1 0
27 32 1 0
25 33 1 0
34 33 2 0
35 34 1 0
36 35 2 0
24 36 1 0
35 37 1 0
37 38 1 0
12 39 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.84Molecular Weight (Monoisotopic): 548.3549AlogP: 7.31#Rotatable Bonds: 12Polar Surface Area: 58.21Molecular Species: BASEHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.92CX LogP: 7.02CX LogD: 5.67Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.19Np Likeness Score: -0.83
References 1. Rodríguez-Soacha DA, Scheiner M, Decker M.. (2019) Multi-target-directed-ligands acting as enzyme inhibitors and receptor ligands., 180 [PMID:31401465 ] [10.1016/j.ejmech.2019.07.040 ]