1-ethyl-6-(3-(2-methoxyethyl)-2-oxo-5-phenyl-2,3-dihydro-1H-imidazol-1-yl)-4-(morpholin-4-yl)quinolin-2(1H)-one

ID: ALA4566995

PubChem CID: 134537290

Max Phase: Preclinical

Molecular Formula: C27H30N4O4

Molecular Weight: 474.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1c(=O)cc(N2CCOCC2)c2cc(-n3c(-c4ccccc4)cn(CCOC)c3=O)ccc21

Standard InChI:  InChI=1S/C27H30N4O4/c1-3-30-23-10-9-21(17-22(23)24(18-26(30)32)28-12-15-35-16-13-28)31-25(20-7-5-4-6-8-20)19-29(27(31)33)11-14-34-2/h4-10,17-19H,3,11-16H2,1-2H3

Standard InChI Key:  CSTWTUNLOLFSII-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   17.1543   -9.0432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8701   -9.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8782  -10.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1745  -10.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4628  -10.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7592  -10.7012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0434  -10.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0312   -9.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7348   -9.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4507   -9.4606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5697   -9.0232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1867  -11.4961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9025  -11.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9147  -12.7166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2110  -13.1340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4952  -12.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4830  -11.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2667  -11.5354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4684  -11.7161    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0509  -11.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5905  -10.3964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3397  -10.7211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4056   -9.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6264   -9.3553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4457   -8.5570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0441   -8.0015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8274   -8.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0081   -9.0426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8828  -12.0749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1478  -12.4695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3328  -12.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0122  -13.3160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1971  -13.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1422   -8.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8458   -7.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  1 10  1  0
  5 10  2  0
  2 11  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 12 17  1  0
  4 12  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 18 22  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
 21 23  1  0
 18 29  2  0
 30 31  1  0
 32 33  1  0
 31 32  1  0
 19 30  1  0
  7 22  1  0
 34 35  1  0
  1 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4566995

    ---

Associated Targets(Human)

HUVEC (11049 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.56Molecular Weight (Monoisotopic): 474.2267AlogP: 3.12#Rotatable Bonds: 7
Polar Surface Area: 70.63Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.81CX LogP: 2.04CX LogD: 2.04
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -1.38

References

1.  (2018)  Nitrogen-containing heterocyclic compound, 

Source