3-(4-methyl-1H-imidazol-1-yl)-N-(3-(3-p-tolyl-1H-pyrazol-5-yl)phenyl)-5-(trifluoromethyl)benzamide

ID: ALA4567137

PubChem CID: 155544690

Max Phase: Preclinical

Molecular Formula: C28H22F3N5O

Molecular Weight: 501.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2cc(-c3cccc(NC(=O)c4cc(-n5cnc(C)c5)cc(C(F)(F)F)c4)c3)[nH]n2)cc1

Standard InChI:  InChI=1S/C28H22F3N5O/c1-17-6-8-19(9-7-17)25-14-26(35-34-25)20-4-3-5-23(11-20)33-27(37)21-10-22(28(29,30)31)13-24(12-21)36-15-18(2)32-16-36/h3-16H,1-2H3,(H,33,37)(H,34,35)

Standard InChI Key:  FJTHHJHRDPNCHM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   27.9688   -1.7664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9677   -2.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6757   -2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3854   -2.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3825   -1.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6739   -1.3576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2623   -2.9973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5161   -2.6643    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9688   -3.2712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3768   -3.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1762   -3.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0937   -2.9930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.8008   -2.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7995   -1.7661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5058   -2.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5058   -3.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2133   -4.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9214   -3.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9174   -2.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2093   -2.5789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0477   -4.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2337   -4.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9008   -5.5517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3808   -6.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1975   -6.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5267   -5.3806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0488   -6.9609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2155   -5.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2163   -5.7790    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.5541   -5.5757    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   32.8780   -5.5742    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.6200   -2.5701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3682   -2.8987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9119   -2.2886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4997   -1.5829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7013   -1.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7250   -2.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  2  0
  2  7  1  0
  4 12  1  0
 12 13  1  0
 13 14  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 10 21  1  0
 24 27  1  0
 28 29  1  0
 28 30  1  0
 28 31  1  0
 17 28  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 32  1  0
 19 32  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4567137

    ---

Associated Targets(Human)

RAF1 Tclin Serine/threonine-protein kinase RAF (4169 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRAF Tclin Serine/threonine-protein kinase B-raf (11587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 501.51Molecular Weight (Monoisotopic): 501.1776AlogP: 6.82#Rotatable Bonds: 5
Polar Surface Area: 75.60Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.61CX Basic pKa: 5.91CX LogP: 6.26CX LogD: 6.24
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.28Np Likeness Score: -1.93

References

1. Jung H, Kim J, Im D, Moon H, Hah JM..  (2019)  Design, synthesis, and in vitro evaluation of N-(3-(3-alkyl-1H-pyrazol-5-yl) phenyl)-aryl amide for selective RAF inhibition.,  29  (4): [PMID:30630714] [10.1016/j.bmcl.2019.01.003]

Source