N-(5-Chloro-2-propoxybenzyl)-2-phenyl-N-(4-(N-(prop-2-yn-1-yl)sulfamoyl)phenethyl)acetamide

ID: ALA4567140

PubChem CID: 155544691

Max Phase: Preclinical

Molecular Formula: C29H31ClN2O4S

Molecular Weight: 539.10

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CCNS(=O)(=O)c1ccc(CCN(Cc2cc(Cl)ccc2OCCC)C(=O)Cc2ccccc2)cc1

Standard InChI:  InChI=1S/C29H31ClN2O4S/c1-3-17-31-37(34,35)27-13-10-23(11-14-27)16-18-32(29(33)20-24-8-6-5-7-9-24)22-25-21-26(30)12-15-28(25)36-19-4-2/h1,5-15,21,31H,4,16-20,22H2,2H3

Standard InChI Key:  KINWLAHPZMYNSZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   36.4517  -27.4048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.0472  -26.6949    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   35.6341  -27.4022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3370  -25.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6274  -25.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9185  -25.4722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9178  -26.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6320  -26.6988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3381  -26.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2069  -25.0590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4948  -25.4712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7874  -25.0579    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0752  -25.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3637  -25.0568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3679  -24.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6572  -23.8267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9440  -24.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9460  -25.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6573  -25.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6601  -26.2911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.7617  -26.2867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7634  -25.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4760  -25.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1810  -24.6396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6582  -23.0095    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   30.3691  -26.6973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3719  -27.5145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0809  -27.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7890  -24.2407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4976  -23.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4992  -23.0163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0822  -23.8307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.2083  -22.6137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2103  -21.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5029  -21.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7920  -21.7980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7935  -22.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 19 20  1  0
  9  2  1  0
  2 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  3  0
 16 25  1  0
 20 26  1  0
 26 27  1  0
 27 28  1  0
 12 29  1  0
 29 30  1  0
 30 31  1  0
 29 32  2  0
 31 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4567140

    ---

Associated Targets(non-human)

Nlrp3 NACHT, LRR and PYD domains-containing protein 3 (641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 539.10Molecular Weight (Monoisotopic): 538.1693AlogP: 4.85#Rotatable Bonds: 13
Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.13CX Basic pKa: CX LogP: 5.37CX LogD: 5.37
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.32Np Likeness Score: -1.63

References

1. Jiang Y, He L, Green J, Blevins H, Guo C, Patel SH, Halquist MS, McRae M, Venitz J, Wang XY, Zhang S..  (2019)  Discovery of Second-Generation NLRP3 Inflammasome Inhibitors: Design, Synthesis, and Biological Characterization.,  62  (21): [PMID:31626545] [10.1021/acs.jmedchem.9b01155]

Source