The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-amino-N-[(2S)-2-(2,5-difluoro-4-piperazin-1-yl-phenyl)propyl]-6-methyl-thieno[2,3-b]pyridine-2-carboxamide ID: ALA4567163
PubChem CID: 153311089
Max Phase: Preclinical
Molecular Formula: C22H25F2N5OS
Molecular Weight: 445.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2c(N)c(C(=O)NC[C@@H](C)c3cc(F)c(N4CCNCC4)cc3F)sc2n1
Standard InChI: InChI=1S/C22H25F2N5OS/c1-12(15-9-17(24)18(10-16(15)23)29-7-5-26-6-8-29)11-27-21(30)20-19(25)14-4-3-13(2)28-22(14)31-20/h3-4,9-10,12,26H,5-8,11,25H2,1-2H3,(H,27,30)/t12-/m1/s1
Standard InChI Key: DIMLWPCIAHNRFA-GFCCVEGCSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
3.0415 -11.8808 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0397 -10.2435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7483 -10.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7536 -11.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5380 -11.7214 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.0164 -11.0523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5295 -10.3895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7769 -9.6109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8336 -11.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2467 -11.7536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2376 -10.3393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0639 -11.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4770 -12.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2942 -12.4497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7012 -13.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5174 -13.1538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6894 -11.7450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5040 -11.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9238 -12.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7410 -12.4375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1508 -13.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9644 -13.1385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3714 -12.4294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9585 -11.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1387 -11.7258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3335 -11.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3301 -10.6508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6265 -11.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0727 -13.1651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2938 -13.8670 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.9044 -11.0237 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26 1 1 0
1 4 2 0
3 2 2 0
2 27 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 3 1 0
7 8 1 0
6 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 19 2 0
18 17 2 0
17 14 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
26 27 2 0
26 28 1 0
13 29 1 6
15 30 1 0
18 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.54Molecular Weight (Monoisotopic): 445.1748AlogP: 3.41#Rotatable Bonds: 5Polar Surface Area: 83.28Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.78CX LogP: 3.39CX LogD: 2.00Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.56Np Likeness Score: -1.72
References 1. (2017) Thienopyridine carboxamides as ubiquitin-specific protease inhibitors,