Benzyl ((2S)-1-(((3S)-5-amino-1-(benzylamino)-2-hydroxy-1,5-dioxopentan-3-yl)amino)-4-methyl-1-oxopentan-2-yl)carbamate

ID: ALA4567259

PubChem CID: 155544685

Max Phase: Preclinical

Molecular Formula: C26H34N4O6

Molecular Weight: 498.58

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(N)=O)C(O)C(=O)NCc1ccccc1

Standard InChI:  InChI=1S/C26H34N4O6/c1-17(2)13-21(30-26(35)36-16-19-11-7-4-8-12-19)24(33)29-20(14-22(27)31)23(32)25(34)28-15-18-9-5-3-6-10-18/h3-12,17,20-21,23,32H,13-16H2,1-2H3,(H2,27,31)(H,28,34)(H,29,33)(H,30,35)/t20-,21-,23?/m0/s1

Standard InChI Key:  WRDSLXQVNSZWEG-MMBKUXRPSA-N

Molfile:  

 
     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
    4.0334   -4.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7479   -3.6333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3188   -3.6333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0334   -4.8708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3188   -2.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6044   -2.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6074   -1.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8937   -1.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1784   -1.5699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1810   -2.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8951   -2.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4614   -4.0465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1768   -3.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5149   -4.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8913   -4.0458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1768   -2.8084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6057   -3.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3202   -4.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0347   -3.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7491   -4.0458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0347   -2.8084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4636   -3.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1781   -4.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1765   -4.8719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8901   -5.2843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6056   -4.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6029   -4.0425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8887   -3.6338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2590   -5.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3378   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9308   -4.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3202   -4.8708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6057   -2.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0126   -2.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8375   -2.0857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5948   -1.3803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  2 12  1  0
 12 13  1  0
 12 14  1  6
 13 15  1  0
 13 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 14 29  1  0
 29 30  1  0
 29 31  1  0
 18 32  1  0
 17 33  1  1
 33 34  1  0
 34 35  2  0
 34 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4567259

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 498.58

Molecular Weight (Monoisotopic): 498.2478

AlogP: 1.37

#Rotatable Bonds: 13

Polar Surface Area: 159.85

Molecular Species: NEUTRAL

HBA: 6

HBD: 5

#RO5 Violations: ┄

HBA (Lipinski): 10

HBD (Lipinski): 6

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 12.40

CX Basic pKa: ┄

CX LogP: 1.36

CX LogD: 1.36

Aromatic Rings: 2

Heavy Atoms: 36

QED Weighted: 0.28

Np Likeness Score: -0.25

References

1. Pacifico S, Ferretti V, Albanese V, Fantinati A, Gallerani E, Nicoli F, Gavioli R, Zamberlan F, Preti D, Marastoni M..  (2019)  Synthesis and Biological Activity of Peptide α-Ketoamide Derivatives as Proteasome Inhibitors.,  10  (7): [PMID:31312413] [10.1021/acsmedchemlett.9b00233]

Source

Source(1):

• Scientific Literature